Difference between revisions of "RXN-14286"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-941 CPD-941] == * smiles: ** CCC(C(SCCC(CCCCC(N)=O)S)=O)C * inchi key: ** InChIKey=UFNCWFSS...") |
(Created page with "Category:Gene == Gene Tiso_gene_17660 == * right end position: ** 2560 * transcription direction: ** NEGATIVE * left end position: ** 1003 * centisome position: ** 14.4670...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_17660 == |
| − | * | + | * right end position: |
| − | ** | + | ** 2560 |
| − | * | + | * transcription direction: |
| − | ** | + | ** NEGATIVE |
| − | * | + | * left end position: |
| − | ** | + | ** 1003 |
| − | * | + | * centisome position: |
| − | ** | + | ** 14.467041 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[DNA-DIRECTED-DNA-POLYMERASE-RXN]] |
| − | + | ** Source: [[annotation-in-silico_annotation]] | |
| − | == | + | *** Assignment: ec-number |
| + | == Pathways associated == | ||
== External links == | == External links == | ||
| − | + | {{#set: right end position=2560}} | |
| − | + | {{#set: transcription direction=NEGATIVE}} | |
| − | + | {{#set: left end position=1003}} | |
| − | + | {{#set: centisome position=14.467041 }} | |
| − | + | {{#set: reaction associated=DNA-DIRECTED-DNA-POLYMERASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 15:52, 21 March 2018
Gene Tiso_gene_17660
- right end position:
- 2560
- transcription direction:
- NEGATIVE
- left end position:
- 1003
- centisome position:
- 14.467041
- Synonym(s):
Reactions associated
- Reaction: DNA-DIRECTED-DNA-POLYMERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
