Difference between revisions of "RXN66-579"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=RGH...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8348 RXN-8348] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8348 RXN-8348] ==
* smiles:
+
* direction:
** C(O)C(O)C(O)C(O)C(O)C(=O)[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=RGHNJXZEOKUKBD-SQOUGZDYSA-M
+
** [http://enzyme.expasy.org/EC/2.10.1.1 EC-2.10.1.1]
* common name:
+
** D-gluconate
+
* molecular weight:
+
** 195.149   
+
 
* Synonym(s):
 
* Synonym(s):
** D-gluconic acid
 
** dextronic acid
 
** maltonic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[GLUCONOLACT-RXN]]
+
** 1 [[CPD-8122]][c] '''+''' 1 [[CPD-3]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CPD-8123]][c]
* [[RXN-17754]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 molybdopterin adenine dinucleotide[c] '''+''' 1 molybdate[c] '''+''' 1 H+[c] '''=>''' 1 AMP[c] '''+''' 1 H2O[c] '''+''' 1 MoO2-molybdopterin cofactor[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_17329]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6823]], molybdenum cofactor biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6823 PWY-6823]
 +
** '''3''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 526-95-4
+
* LIGAND-RXN:
* METABOLIGHTS : MTBLC18391
+
** [http://www.genome.jp/dbget-bin/www_bget?R09735 R09735]
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419706 6419706]
+
{{#set: ec number=EC-2.10.1.1}}
* HMDB : HMDB00625
+
{{#set: gene associated=Tiso_gene_17329}}
* LIGAND-CPD:
+
{{#set: in pathway=PWY-6823}}
** [http://www.genome.jp/dbget-bin/www_bget?C00257 C00257]
+
{{#set: reconstruction category=orthology}}
* CHEMSPIDER:
+
{{#set: reconstruction source=orthology-esiliculosus}}
** [http://www.chemspider.com/Chemical-Structure.4925340.html 4925340]
+
{{#set: reconstruction tool=pantograph}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18391 18391]
+
* BIGG : glcn
+
{{#set: smiles=C(O)C(O)C(O)C(O)C(O)C(=O)[O-]}}
+
{{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-SQOUGZDYSA-M}}
+
{{#set: common name=D-gluconate}}
+
{{#set: molecular weight=195.149    }}
+
{{#set: common name=D-gluconic acid|dextronic acid|maltonic acid}}
+
{{#set: produced by=GLUCONOLACT-RXN|RXN-17754}}
+

Revision as of 15:52, 21 March 2018

Reaction RXN-8348

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 molybdopterin adenine dinucleotide[c] + 1 molybdate[c] + 1 H+[c] => 1 AMP[c] + 1 H2O[c] + 1 MoO2-molybdopterin cofactor[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6823, molybdenum cofactor biosynthesis: PWY-6823
    • 3 reactions found over 8 reactions in the full pathway

Reconstruction information

External links