Difference between revisions of "Tiso gene 3523"

Revision as of 16:53, 21 March 2018

@@ Line 1: / Line 1: @@
-[[Category:Metabolite]]
+[[Category:Gene]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] ==
+== Gene Tiso_gene_507 ==
-* smiles:
-** CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
-* inchi key:
-** InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J
-* common name:
-** 3-oxo-(7Z)-hexadecenoyl-CoA
-* molecular weight:
-** 1013.883
 * Synonym(s):
-** 3-oxo-16:1-&Delta;7-CoA
-** 3-oxo-7-cis-hexadecenoyl-CoA
-== Reaction(s) known to consume the compound ==
+== Reactions associated ==
-* [[RXN-17782]]
+* Reaction: [[RXN-8036]]
-== Reaction(s) known to produce the compound ==
+** Source: [[orthology-athaliana]]
-* [[RXN-17781]]
+== Pathways associated ==
-== Reaction(s) of unknown directionality ==
+* [[PWY-5176]]
 == External links  ==
-{{#set: smiles=CCCCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+{{#set: reaction associated=RXN-8036}}
-{{#set: inchi key=InChIKey=BUCIFQOXNYHEOO-YDGGZUKGSA-J}}
+{{#set: pathway associated=PWY-5176}}
-{{#set: common name=3-oxo-(7Z)-hexadecenoyl-CoA}}
-{{#set: molecular weight=1013.883    }}
-{{#set: common name=3-oxo-16:1-&Delta;7-CoA|3-oxo-7-cis-hexadecenoyl-CoA}}
-{{#set: consumed by=RXN-17782}}
-{{#set: produced by=RXN-17781}}