Difference between revisions of "Tiso gene 10542"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] == * smiles: ** COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O) * inchi key: ** InChIKe...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-4222 RXN0-4222] == * direction: ** LEFT-TO-RIGHT * common name: ** exosome_complex_exonuclease...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-4222 RXN0-4222] ==
−
* smiles:
+
* direction:
−
** COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-M
+
 
* common name:
 
* common name:
−
** sinapate
+
** exosome_complex_exonuclease
−
* molecular weight:
+
* ec number:
−
** 223.205   
+
** [http://enzyme.expasy.org/EC/3.1.13.1 EC-3.1.13.1]
 
* Synonym(s):
 
* Synonym(s):
−
** 3,5-dimethoxy-4-hydroxycinnamate
 
−
** sinapinate
 
−
** sinapinic acid
 
−
** sinapic acid
 
−
** 3,5-dimethoxy-4-hydroxycinnamic acid
 
−
** 4-hydroxy-3,5-dimethoxycinnamate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10919]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[CPD0-2351]][c] '''=>''' 1 [[Ribonucleoside-Monophosphates]][c] '''+''' 1 [[CPD0-2354]][c]
−
* [[RXN-3422]]
+
* With common name(s):
−
* [[RXN-8014]]
+
** 1 H2O[c] '''+''' 1 a tRNA precursor with a 5' extension and a long 3' trailer[c] '''=>''' 1 a ribonucleoside 5'-monophosphate[c] '''+''' 1 a tRNA precursor with a 5' extension[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11613]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_11612]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY0-1479]], tRNA processing: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1479 PWY0-1479]
 +
** '''4''' reactions found over '''10''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=59261 59261]
+
{{#set: common name=exosome_complex_exonuclease}}
−
* CAS : 530-59-6
+
{{#set: ec number=EC-3.1.13.1}}
−
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_11613|Tiso_gene_11612}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54710960 54710960]
+
{{#set: in pathway=PWY0-1479}}
−
* HMDB : HMDB32616
+
{{#set: reconstruction category=annotation}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00482 C00482]
+
{{#set: reconstruction tool=pathwaytools}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4573878.html 4573878]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30023 30023]
+
−
{{#set: smiles=COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=PCMORTLOPMLEFB-ONEGZZNKSA-M}}
+
−
{{#set: common name=sinapate}}
+
−
{{#set: molecular weight=223.205    }}
+
−
{{#set: common name=3,5-dimethoxy-4-hydroxycinnamate|sinapinate|sinapinic acid|sinapic acid|3,5-dimethoxy-4-hydroxycinnamic acid|4-hydroxy-3,5-dimethoxycinnamate}}
+
−
{{#set: consumed by=RXN-10919}}
+
−
{{#set: produced by=RXN-3422|RXN-8014}}
+

Revision as of 15:53, 21 March 2018

Reaction RXN0-4222

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • exosome_complex_exonuclease
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 a tRNA precursor with a 5' extension and a long 3' trailer[c] => 1 a ribonucleoside 5'-monophosphate[c] + 1 a tRNA precursor with a 5' extension[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY0-1479, tRNA processing: PWY0-1479
    • 4 reactions found over 10 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10542&oldid=37008"