Difference between revisions of "O-SUCCHOMOSERLYASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] == * smiles: ** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-] *...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12611 RXN-12611] == * direction: ** LEFT-TO-RIGHT * common name: ** thiamin phosphate synthase...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12611 RXN-12611] ==
−
* smiles:
+
* direction:
−
** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L
+
 
* common name:
 
* common name:
−
** 2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one
+
** thiamin phosphate synthase
−
* molecular weight:
+
** ORF
−
** 353.228   
+
** thiamine_monophosphate_synthase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.5.1.3 EC-2.5.1.3]
 
* Synonym(s):
 
* Synonym(s):
−
** 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10058]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP]][c] '''+''' 1 [[CPD-13575]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[THIAMINE-P]][c] '''+''' 1 [[PPI]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 4-amino-2-methyl-5-(diphosphomethyl)pyrimidine[c] '''+''' 1 2-[(2R,5Z)-2-carboxy-4-methylthiazol-5(2H)-ylidene]ethyl phosphate[c] '''+''' 2 H+[c] '''=>''' 1 CO2[c] '''+''' 1 thiamine phosphate[c] '''+''' 1 diphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_2159]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_2160]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10320]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6894]], thiamine diphosphate biosynthesis I (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6894 PWY-6894]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480553 45480553]
+
{{#set: common name=thiamin phosphate synthase}}
−
* CHEBI:
+
{{#set: common name=ORF}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58890 58890]
+
{{#set: common name=thiamine_monophosphate_synthase}}
−
{{#set: smiles=C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]}}
+
{{#set: ec number=EC-2.5.1.3}}
−
{{#set: inchi key=InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L}}
+
{{#set: gene associated=Tiso_gene_2159|Tiso_gene_2160|Tiso_gene_10320}}
−
{{#set: common name=2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one}}
+
{{#set: in pathway=PWY-6894}}
−
{{#set: molecular weight=353.228    }}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
{{#set: consumed by=RXN-10058}}
+
{{#set: reconstruction tool=pathwaytools}}

Revision as of 15:53, 21 March 2018

Reaction RXN-12611

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • thiamin phosphate synthase
    • ORF
    • thiamine_monophosphate_synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6894, thiamine diphosphate biosynthesis I (E. coli): PWY-6894
    • 1 reactions found over 2 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=O-SUCCHOMOSERLYASE-RXN&oldid=37038"