Difference between revisions of "3-DEHYDROQUINATE-DEHYDRATASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_18652 == * right end position: ** 2678 * transcription direction: ** POSITIVE * left end position: ** 51 * centisome position: ** 1.7665397...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18652 == |
− | * | + | * right end position: |
− | ** | + | ** 2678 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 51 |
− | * | + | * centisome position: |
− | ** | + | ** 1.7665397 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[GLYOHMETRANS-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | == | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | * Reaction: [[RXN0-5234]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-2161]] | ||
+ | * [[PWY-1622]] | ||
+ | * [[PWY-3841]] | ||
+ | * [[1CMET2-PWY]] | ||
+ | * [[PWY-3661]] | ||
+ | * [[GLYSYN-PWY]] | ||
+ | * [[PWY-5497]] | ||
+ | * [[PWY-2201]] | ||
+ | * [[PWY-181]] | ||
+ | * [[PWY-3661-1]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2678}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=51}} | |
− | + | {{#set: centisome position=1.7665397 }} | |
− | + | {{#set: reaction associated=GLYOHMETRANS-RXN|RXN0-5234}} | |
− | + | {{#set: pathway associated=PWY-2161|PWY-1622|PWY-3841|1CMET2-PWY|PWY-3661|GLYSYN-PWY|PWY-5497|PWY-2201|PWY-181|PWY-3661-1}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:53, 21 March 2018
Gene Tiso_gene_18652
- right end position:
- 2678
- transcription direction:
- POSITIVE
- left end position:
- 51
- centisome position:
- 1.7665397
- Synonym(s):
Reactions associated
- Reaction: GLYOHMETRANS-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN0-5234
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation