Difference between revisions of "3-KETOLACTOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOP-2229-ENE HOP-2229-ENE] == * smiles: ** C=C(C)C5(CCC4(C)([CH](CCC2(C)([CH](CC[CH]1(C3(C)(CCC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15104 CPD-15104] == * smiles: ** CCC(O)(C)C(=O)C(=O)[O-] * common name: ** (R)-3-hydroxy-3-...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15104 CPD-15104] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCC(O)(C)C(=O)C(=O)[O-] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** (R)-3-hydroxy-3-methyl-2-oxopentanoate |
| + | * inchi key: | ||
| + | ** InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 145.135 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[R05068]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-14106]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20846131 20846131] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49257 49257] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C14463 C14463] |
| − | {{#set: smiles= | + | {{#set: smiles=CCC(O)(C)C(=O)C(=O)[O-]}} |
| − | {{#set: | + | {{#set: common name=(R)-3-hydroxy-3-methyl-2-oxopentanoate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=145.135 }} |
| − | {{#set: | + | {{#set: consumed by=R05068}} |
| − | {{#set: | + | {{#set: reversible reaction associated=RXN-14106}} |
Revision as of 15:53, 21 March 2018
Contents
Metabolite CPD-15104
- smiles:
- CCC(O)(C)C(=O)C(=O)[O-]
- common name:
- (R)-3-hydroxy-3-methyl-2-oxopentanoate
- inchi key:
- InChIKey=YJVOWRAWFXRESP-ZCFIWIBFSA-M
- molecular weight:
- 145.135
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC(O)(C)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.
