Difference between revisions of "CPD-703"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12020 == * left end position: ** 5419 * transcription direction: ** POSITIVE * right end position: ** 5829 * centisome position: ** 73.5977...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) * common...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) |
| − | * | + | * common name: |
| − | ** | + | ** α-D-glucose 6-phosphate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L |
| − | * | + | * molecular weight: |
| − | ** | + | ** 258.121 |
* Synonym(s): | * Synonym(s): | ||
| + | ** α-glucose 6-phosphate | ||
| + | ** α-D-glucose-6-P | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[UG6PGT]] |
| − | * | + | * [[UG6PGTn]] |
| − | + | * [[G6PADHh]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * [[RXN- | + | * [[BFFS]] |
| − | + | * [[RXN-1685]] | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | * [[PGIA]] | |
| − | * [[ | + | * [[PGIAh]] |
| − | + | * [[G6PI]] | |
| − | + | * [[G6PA_pi_th]] | |
| − | + | * [[RXN-6182]] | |
| − | * [[ | + | * [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]] |
| − | * [[ | + | * [[PGMTh]] |
| − | * [[ | + | * [[PGCM]] |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604864 21604864] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10239175.html 10239175] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58225 58225] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00668 C00668] | ||
| + | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)}} | ||
| + | {{#set: common name=α-D-glucose 6-phosphate}} | ||
| + | {{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L}} | ||
| + | {{#set: molecular weight=258.121 }} | ||
| + | {{#set: common name=α-glucose 6-phosphate|α-D-glucose-6-P}} | ||
| + | {{#set: consumed by=UG6PGT|UG6PGTn|G6PADHh}} | ||
| + | {{#set: produced by=BFFS|RXN-1685}} | ||
| + | {{#set: reversible reaction associated=PGIA|PGIAh|G6PI|G6PA_pi_th|RXN-6182|GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN|PGMTh|PGCM}} | ||
Revision as of 16:53, 21 March 2018
Contents
Metabolite ALPHA-GLC-6-P
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)
- common name:
- α-D-glucose 6-phosphate
- inchi key:
- InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L
- molecular weight:
- 258.121
- Synonym(s):
- α-glucose 6-phosphate
- α-D-glucose-6-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.
