Difference between revisions of "FORMALDEHYDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DOPACHROME L-DOPACHROME] == * smiles: ** C([O-])(=O)C1(NC2(C(C1)=CC(=O)C(=O)C=2)) * inchi key...") |
(Created page with "Category:Gene == Gene Tiso_gene_10122 == * Synonym(s): == Reactions associated == * Reaction: NAD+-ADP-RIBOSYLTRANSFERASE-RXN ** Source: annotation-in-silico_annota...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_10122 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 15:54, 21 March 2018
Gene Tiso_gene_10122
- Synonym(s):
Reactions associated
- Reaction: NAD+-ADP-RIBOSYLTRANSFERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation