Difference between revisions of "CPD-16551"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2123 CPD0-2123] == * smiles: ** CCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PSEUDOURIDINE-5-P PSEUDOURIDINE-5-P] == * smiles: ** C1(NC(=O)NC(=O)C=1C2(OC(COP(=O)([O-])[O-])...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PSEUDOURIDINE-5-P PSEUDOURIDINE-5-P] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(NC(=O)NC(=O)C=1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2)) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** pseudouridine 5'-phosphate |
+ | * inchi key: | ||
+ | ** InChIKey=MOBMOJGXNHLLIR-GBNDHIKLSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 322.168 |
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[RXN0-5398]] |
== External links == | == External links == | ||
− | * | + | * CAS : 1157-60-4 |
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245232 25245232] |
− | * HMDB : | + | * HMDB : HMDB01271 |
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58380 58380] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01168 C01168] |
− | {{#set: | + | {{#set: smiles=C1(NC(=O)NC(=O)C=1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))}} |
− | {{#set: | + | {{#set: common name=pseudouridine 5'-phosphate}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=MOBMOJGXNHLLIR-GBNDHIKLSA-L}} |
− | + | {{#set: molecular weight=322.168 }} | |
− | + | {{#set: reversible reaction associated=RXN0-5398}} | |
− | {{#set: reversible reaction associated= | + |
Revision as of 16:54, 21 March 2018
Contents
Metabolite PSEUDOURIDINE-5-P
- smiles:
- C1(NC(=O)NC(=O)C=1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))
- common name:
- pseudouridine 5'-phosphate
- inchi key:
- InChIKey=MOBMOJGXNHLLIR-GBNDHIKLSA-L
- molecular weight:
- 322.168
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC(=O)NC(=O)C=1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))" cannot be used as a page name in this wiki.