Difference between revisions of "Tiso gene 11635"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] == * smiles: ** C(OP([O-])(=O)[O-])C(O)CO * inchi key: ** InChIKey=AWU...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CO3 CO3] == * smiles: ** C([O-])(=O)[O-] * common name: ** carbonate * inchi key: ** InChIKey=B...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CO3 CO3] == |
* smiles: | * smiles: | ||
− | ** C | + | ** C([O-])(=O)[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** carbonate |
+ | * inchi key: | ||
+ | ** InChIKey=BVKZGUZCCUSVTD-UHFFFAOYSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 60.009 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** CO3 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | + | * [[RXN-18032]] | |
− | * [[RXN- | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=19660 19660] |
− | + | ||
− | + | ||
− | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
− | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.18519.html 18519] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=41609 41609] |
− | * | + | * HMDB : HMDB31453 |
− | {{#set: smiles=C | + | {{#set: smiles=C([O-])(=O)[O-]}} |
− | {{#set: | + | {{#set: common name=carbonate}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=BVKZGUZCCUSVTD-UHFFFAOYSA-L}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=60.009 }} |
− | {{#set: common name= | + | {{#set: common name=CO3}} |
− | + | {{#set: reversible reaction associated=RXN-18032}} | |
− | + | ||
− | {{#set: reversible reaction associated= | + |
Revision as of 16:54, 21 March 2018
Contents
Metabolite CO3
- smiles:
- C([O-])(=O)[O-]
- common name:
- carbonate
- inchi key:
- InChIKey=BVKZGUZCCUSVTD-UHFFFAOYSA-L
- molecular weight:
- 60.009
- Synonym(s):
- CO3
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)[O-" cannot be used as a page name in this wiki.