Difference between revisions of "CD-2S-SP-Complex"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-375 CPD-375] == * smiles: ** CC1(=C(C2(=C(C=N1)COC2=O))O) * inchi key: ** InChIKey=HHPDVQLB...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.139-RXN 2.7.1.139-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ras-related_gtp-bin...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.139-RXN 2.7.1.139-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** ras-related_gtp-binding_protein |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.1.159 EC-2.7.1.159] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[INOSITOL-1-3-4-TRIPHOSPHATE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-506]][c] '''+''' 1 [[ADP]][c] |
− | == | + | * With common name(s): |
+ | ** 1 D-myo-inositol (1,3,4)-trisphosphate[c] '''+''' 1 ATP[c] '''=>''' 1 H+[c] '''+''' 1 D-myo-inositol (1,3,4,5)-tetrakisphosphate[c] '''+''' 1 ADP[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_15232]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6554]], 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6554 PWY-6554] | ||
+ | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13253 13253] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03428 R03428] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | ** [http://www.ebi.ac.uk/ | + | {{#set: common name=ras-related_gtp-binding_protein}} |
− | * LIGAND- | + | {{#set: ec number=EC-2.7.1.159}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=Tiso_gene_15232}} |
− | + | {{#set: in pathway=PWY-6554}} | |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:54, 21 March 2018
Contents
Reaction 2.7.1.139-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- ras-related_gtp-binding_protein
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 INOSITOL-1-3-4-TRIPHOSPHATE[c] + 1 ATP[c] => 1 PROTON[c] + 1 CPD-506[c] + 1 ADP[c]
- With common name(s):
- 1 D-myo-inositol (1,3,4)-trisphosphate[c] + 1 ATP[c] => 1 H+[c] + 1 D-myo-inositol (1,3,4,5)-tetrakisphosphate[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_15232
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
- PWY-6554, 1D-myo-inositol hexakisphosphate biosynthesis V (from Ins(1,3,4)P3): PWY-6554
- 4 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links