Difference between revisions of "DGTCY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COBINAMIDE COBINAMIDE] == * smiles: ** CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C...")
(Created page with "Category:Gene == Gene Tiso_gene_2631 == * right end position: ** 18267 * transcription direction: ** NEGATIVE * left end position: ** 14517 * centisome position: ** 77.626...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COBINAMIDE COBINAMIDE] ==
+
== Gene Tiso_gene_2631 ==
−
* smiles:
+
* right end position:
−
** CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))
+
** 18267
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XQRJFEVDQXEIAX-JFYQDRLCSA-M
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** cobinamide
+
** 14517
−
* molecular weight:
+
* centisome position:
−
** 990.096    
+
** 77.62687    
 
* Synonym(s):
 
* Synonym(s):
−
** Cbi
 
−
** cobyrinic acid a,c-diamide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[BTUR2-RXN]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12195]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12196]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-5462]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1867-62-5
+
{{#set: right end position=18267}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820010 91820010]
+
{{#set: left end position=14517}}
−
* HMDB : HMDB06902
+
{{#set: centisome position=77.62687   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05774 C05774]
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28956 28956]
+
−
* BIGG : cbi
+
−
{{#set: smiles=CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))}}
+
−
{{#set: inchi key=InChIKey=XQRJFEVDQXEIAX-JFYQDRLCSA-M}}
+
−
{{#set: common name=cobinamide}}
+
−
{{#set: molecular weight=990.096   }}
+
−
{{#set: common name=Cbi|cobyrinic acid a,c-diamide}}
+
−
{{#set: consumed by=BTUR2-RXN}}
+

Revision as of 15:54, 21 March 2018

Gene Tiso_gene_2631

  • right end position:
    • 18267
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 14517
  • centisome position:
    • 77.62687
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DGTCY&oldid=37275"