Difference between revisions of "L-DOPACHROME"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-178 CPD-178] == * smiles: ** C1(O)(C(O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7Z-3-oxo-hexadec-7-enoyl-ACPs 7Z-3-oxo-hexadec-7-enoyl-ACPs] == * common name: ** a (7Z)-3-oxo-...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-178 CPD-178] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7Z-3-oxo-hexadec-7-enoyl-ACPs 7Z-3-oxo-hexadec-7-enoyl-ACPs] ==
−
* smiles:
+
−
** C1(O)(C(O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)
+
−
* inchi key:
+
−
** InChIKey=MRVYFOANPDTYBY-UZAAGFTCSA-F
+
 
* common name:
 
* common name:
−
** D-myo-inositol (3,4,5,6)-tetrakisphosphate
+
** a (7Z)-3-oxo-hexadec-7-enoyl-[acp]
−
* molecular weight:
+
−
** 492.013   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Ins(3,4,5,6)P4
 
−
** Inositol 3,4,5,6-tetrakisphosphate
 
−
** 1D-myo-inositol 3,4,5,6-tetrakisphosphate
 
−
** I(3,4,5,6)P4
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[2.7.1.134-RXN]]
+
* [[RXN-16622]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10955]]
+
* [[RXN-16621]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=a (7Z)-3-oxo-hexadec-7-enoyl-[acp]}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04520 C04520]
+
{{#set: consumed by=RXN-16622}}
−
* CHEBI:
+
{{#set: produced by=RXN-16621}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57539 57539]
+
−
* METABOLIGHTS : MTBLC57539
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201333 25201333]
+
−
* HMDB : HMDB03848
+
−
{{#set: smiles=C1(O)(C(O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)}}
+
−
{{#set: inchi key=InChIKey=MRVYFOANPDTYBY-UZAAGFTCSA-F}}
+
−
{{#set: common name=D-myo-inositol (3,4,5,6)-tetrakisphosphate}}
+
−
{{#set: molecular weight=492.013    }}
+
−
{{#set: common name=Ins(3,4,5,6)P4|Inositol 3,4,5,6-tetrakisphosphate|1D-myo-inositol 3,4,5,6-tetrakisphosphate|I(3,4,5,6)P4}}
+
−
{{#set: consumed by=2.7.1.134-RXN}}
+
−
{{#set: produced by=RXN-10955}}
+

Revision as of 16:55, 21 March 2018

Metabolite 7Z-3-oxo-hexadec-7-enoyl-ACPs

  • common name:
    • a (7Z)-3-oxo-hexadec-7-enoyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (7Z)-3-oxo-hexadec-7-enoyl-[acp" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=L-DOPACHROME&oldid=37305"