Difference between revisions of "Tiso gene 11760"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] == * smiles: ** CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.26.3-RXN 3.1.26.3-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** low_quality_protein:_...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.26.3-RXN 3.1.26.3-RXN] ==
* smiles:
+
* direction:
** CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J
+
 
* common name:
 
* common name:
** OPC4-3-hydroxyacyl-CoA
+
** low_quality_protein:_ribonuclease_3-like
* molecular weight:
+
** mini-ribonuclease_3
** 999.813   
+
** ORF
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/3.1.26.3 EC-3.1.26.3]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-10703]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[RNASE-III-MRNA-PROCESSING-SUBSTRATE]][c] '''+''' 2 [[WATER]][c] '''=>''' 1 [[RNASE-III-PROCESSING-PRODUCT-MRNA]][c] '''+''' 2 [[mRNA-Fragments]][c]
* [[RXN-10705]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 RNase III mRNA processing substrate[c] '''+''' 2 H2O[c] '''=>''' 1 RNase III processing product mRNA[c] '''+''' 2 an mRNA fragment[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10131]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_6282]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10752]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10753]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10649]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_608]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* UNIPROT:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237301 44237301]
+
** [http://www.uniprot.org/uniprot/Q9PM40 Q9PM40]
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
+
** [http://www.uniprot.org/uniprot/P51833 P51833]
{{#set: inchi key=InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J}}
+
** [http://www.uniprot.org/uniprot/Q9CHD0 Q9CHD0]
{{#set: common name=OPC4-3-hydroxyacyl-CoA}}
+
** [http://www.uniprot.org/uniprot/Q9JVD3 Q9JVD3]
{{#set: molecular weight=999.813    }}
+
** [http://www.uniprot.org/uniprot/P44441 P44441]
{{#set: consumed by=RXN-10703}}
+
** [http://www.uniprot.org/uniprot/P0A7Y0 P0A7Y0]
{{#set: produced by=RXN-10705}}
+
** [http://www.uniprot.org/uniprot/P09155 P09155]
 +
** [http://www.uniprot.org/uniprot/Q52698 Q52698]
 +
** [http://www.uniprot.org/uniprot/Q49034 Q49034]
 +
** [http://www.uniprot.org/uniprot/O69469 O69469]
 +
{{#set: direction=LEFT-TO-RIGHT}}
 +
{{#set: common name=low_quality_protein:_ribonuclease_3-like}}
 +
{{#set: common name=mini-ribonuclease_3}}
 +
{{#set: common name=ORF}}
 +
{{#set: ec number=EC-3.1.26.3}}
 +
{{#set: gene associated=Tiso_gene_10131|Tiso_gene_6282|Tiso_gene_10752|Tiso_gene_10753|Tiso_gene_10649|Tiso_gene_608}}
 +
{{#set: in pathway=}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Revision as of 15:55, 21 March 2018

Reaction 3.1.26.3-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • low_quality_protein:_ribonuclease_3-like
    • mini-ribonuclease_3
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links