Difference between revisions of "TRNA-Containing-N2-Methylguanine-26"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19490 CPD-19490] == * smiles: ** CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=...")
(Created page with "Category:Gene == Gene Tiso_gene_4719 == * right end position: ** 5461 * transcription direction: ** POSITIVE * left end position: ** 4094 * centisome position: ** 28.36162...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19490 CPD-19490] ==
+
== Gene Tiso_gene_4719 ==
−
* smiles:
+
* right end position:
−
** CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
+
** 5461
−
* inchi key:
+
* transcription direction:
−
** InChIKey=XXJZWLKRFPCKLB-UHFFFAOYSA-L
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 3-isopropyl-7-(methylthio)-2-oxoheptanoate
+
** 4094
−
* molecular weight:
+
* centisome position:
−
** 232.251    
+
** 28.361622    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-18207]]
+
* Reaction: [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
−
* [[RXN-18206]]
+
* Reaction: [[GPPSYN-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-7736]]
 +
* [[PWY-7410]]
 +
* [[PWY-6859]]
 +
* [[PWY-7709]]
 +
* [[PWY-7102]]
 +
* [[PWY-7182]]
 +
* [[PWY-6708]]
 +
* [[PWY-7141]]
 +
* [[PWY-5123]]
 +
* [[PWY-5122]]
 +
* [[PWY-6383]]
 +
* [[PWY-7659]]
 +
* [[PWY-5870]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CSCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}}
+
{{#set: right end position=5461}}
−
{{#set: inchi key=InChIKey=XXJZWLKRFPCKLB-UHFFFAOYSA-L}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=3-isopropyl-7-(methylthio)-2-oxoheptanoate}}
+
{{#set: left end position=4094}}
−
{{#set: molecular weight=232.251   }}
+
{{#set: centisome position=28.361622   }}
−
{{#set: consumed by=RXN-18207}}
+
{{#set: reaction associated=4OHBENZOATE-OCTAPRENYLTRANSFER-RXN|GPPSYN-RXN}}
−
{{#set: reversible reaction associated=RXN-18206}}
+
{{#set: pathway associated=PWY-7736|PWY-7410|PWY-6859|PWY-7709|PWY-7102|PWY-7182|PWY-6708|PWY-7141|PWY-5123|PWY-5122|PWY-6383|PWY-7659|PWY-5870}}

Revision as of 15:55, 21 March 2018

Gene Tiso_gene_4719

  • right end position:
    • 5461
  • transcription direction:
    • POSITIVE
  • left end position:
    • 4094
  • centisome position:
    • 28.361622
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TRNA-Containing-N2-Methylguanine-26&oldid=37317"