Difference between revisions of "Tiso gene 3271"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(...")
(Created page with "Category:Gene == Gene Tiso_gene_16795 == * right end position: ** 6204 * transcription direction: ** NEGATIVE * left end position: ** 3823 * centisome position: ** 53.2377...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XTP XTP] ==
+
== Gene Tiso_gene_16795 ==
−
* smiles:
+
* right end position:
−
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))
+
** 6204
−
* inchi key:
+
* transcription direction:
−
** InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** XTP
+
** 3823
−
* molecular weight:
+
* centisome position:
−
** 520.136    
+
** 53.237713    
 
* Synonym(s):
 
* Synonym(s):
−
** xanthosine 5' triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN0-1603]]
+
* Reaction: [[1.3.99.23-RXN]]
−
* [[NTPD]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[R95]]
 +
** Source: [[orthology-synechocystis]]
 +
* Reaction: [[R96]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: right end position=6204}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00700 C00700]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=3823}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61314 61314]
+
{{#set: centisome position=53.237713   }}
−
* BIGG : xtp
+
{{#set: reaction associated=1.3.99.23-RXN|R95|R96}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245622 25245622]
+
−
* HMDB : HMDB00293
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))}}
+
−
{{#set: inchi key=InChIKey=CAEFEWVYEZABLA-UUOKFMHZSA-J}}
+
−
{{#set: common name=XTP}}
+
−
{{#set: molecular weight=520.136   }}
+
−
{{#set: common name=xanthosine 5' triphosphate}}
+
−
{{#set: consumed by=RXN0-1603|NTPD}}
+

Revision as of 15:55, 21 March 2018

Gene Tiso_gene_16795

  • right end position:
    • 6204
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 3823
  • centisome position:
    • 53.237713
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3271&oldid=37325"