Difference between revisions of "RXN-13444"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-1-PHENYLETHANOL S-1-PHENYLETHANOL] == * smiles: ** CC(O)C1(C=CC=CC=1) * inchi key: ** InChIKe...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AKGCITtm AKGCITtm] == * direction: ** REVERSIBLE * common name: ** Dicarboxylate/tricarboxylate car...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-1-PHENYLETHANOL S-1-PHENYLETHANOL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AKGCITtm AKGCITtm] ==
* smiles:
+
* direction:
** CC(O)C1(C=CC=CC=1)
+
** REVERSIBLE
* inchi key:
+
** InChIKey=WAPNOHKVXSQRPX-ZETCQYMHSA-N
+
 
* common name:
 
* common name:
** (S)-1-phenylethanol
+
** Dicarboxylate/tricarboxylate carrier (akg:cit), mitochondrial
* molecular weight:
+
** 122.166   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1.0 [[CIT]][m] '''+''' 1.0 [[2-KETOGLUTARATE]][c] '''<=>''' 1.0 [[CIT]][c] '''+''' 1.0 [[2-KETOGLUTARATE]][m]
* [[RXN-1302]]
+
* With common name(s):
 +
** 1.0 citrate[m] '''+''' 1.0 2-oxoglutarate[c] '''<=>''' 1.0 citrate[c] '''+''' 1.0 2-oxoglutarate[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14857]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=443135 443135]
+
{{#set: common name=Dicarboxylate/tricarboxylate carrier (akg:cit), mitochondrial}}
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_14857}}
** [http://www.chemspider.com/Chemical-Structure.391409.html 391409]
+
{{#set: in pathway=}}
* CHEBI:
+
{{#set: reconstruction category=orthology}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16346 16346]
+
{{#set: reconstruction source=orthology-creinhardtii}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.genome.jp/dbget-bin/www_bget?C11348 C11348]
+
{{#set: smiles=CC(O)C1(C=CC=CC=1)}}
+
{{#set: inchi key=InChIKey=WAPNOHKVXSQRPX-ZETCQYMHSA-N}}
+
{{#set: common name=(S)-1-phenylethanol}}
+
{{#set: molecular weight=122.166    }}
+
{{#set: reversible reaction associated=RXN-1302}}
+

Revision as of 15:55, 21 March 2018

Reaction AKGCITtm

  • direction:
    • REVERSIBLE
  • common name:
    • Dicarboxylate/tricarboxylate carrier (akg:cit), mitochondrial
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 citrate[m] + 1.0 2-oxoglutarate[c] <=> 1.0 citrate[c] + 1.0 2-oxoglutarate[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links