Difference between revisions of "Tiso gene 20095"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13008 CPD-13008] == * smiles: ** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N2-Methylguanine-26 tRNA-Containing-N2-Methylguanine-26] == * common name: ** a...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13008 CPD-13008] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-N2-Methylguanine-26 tRNA-Containing-N2-Methylguanine-26] ==
* smiles:
+
** C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O
+
* inchi key:
+
** InChIKey=LROTZSUGDZPWDN-ZDUSSCGKSA-N
+
 
* common name:
 
* common name:
** 3',5'-diiodothyronine
+
** an N2-methylguanine26 in tRNA
* molecular weight:
+
** 525.081   
+
 
* Synonym(s):
 
* Synonym(s):
** 3',5'-diiodo-L-thyronine
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12037]]
+
* [[RXN-12376]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12375]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an N2-methylguanine26 in tRNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986088 50986088]
+
{{#set: consumed by=RXN-12376}}
{{#set: smiles=C(C(CC1(=CC=C(C=C1)OC2(=CC(I)=C(C(I)=C2)O)))[N+])([O-])=O}}
+
{{#set: produced by=RXN-12375}}
{{#set: inchi key=InChIKey=LROTZSUGDZPWDN-ZDUSSCGKSA-N}}
+
{{#set: common name=3',5'-diiodothyronine}}
+
{{#set: molecular weight=525.081    }}
+
{{#set: common name=3',5'-diiodo-L-thyronine}}
+
{{#set: consumed by=RXN-12037}}
+

Revision as of 15:56, 21 March 2018

Metabolite tRNA-Containing-N2-Methylguanine-26

  • common name:
    • an N2-methylguanine26 in tRNA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links