Difference between revisions of "RXN-14014"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-]...")
(Created page with "Category:Gene == Gene Tiso_gene_12835 == * right end position: ** 2273 * transcription direction: ** NEGATIVE * left end position: ** 89 * centisome position: ** 1.3281599...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] ==
+
== Gene Tiso_gene_12835 ==
−
* smiles:
+
* right end position:
−
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC5(C(O)C4(C(OP([O-])(=O)O4)O5)))([O-])=O
+
** 2273
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** ADP ribose 1'',2''-cyclic phosphate
+
** 89
−
* molecular weight:
+
* centisome position:
−
** 618.26    
+
** 1.3281599    
 
* Synonym(s):
 
* Synonym(s):
−
** ADP ribose 1''-2''-cyclic phosphate
 
−
** ADP ribose 1'',2''-phosphate
 
−
** adenosine diphosphate ribose 1'',2''-cyclic phosphate
 
−
** Appr>p
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[CARBOXYMETHYLENEBUTENOLIDASE-RXN]]
−
* [[2.7.1.160-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-9868]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6087]]
 +
* [[PWY-6193]]
 +
* [[PWY-6089]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2273}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245989 25245989]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=89}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76596 76596]
+
{{#set: centisome position=1.3281599   }}
−
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC5(C(O)C4(C(OP([O-])(=O)O4)O5)))([O-])=O}}
+
{{#set: reaction associated=CARBOXYMETHYLENEBUTENOLIDASE-RXN|RXN-9868}}
−
{{#set: inchi key=InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K}}
+
{{#set: pathway associated=PWY-6087|PWY-6193|PWY-6089}}
−
{{#set: common name=ADP ribose 1'',2''-cyclic phosphate}}
+
−
{{#set: molecular weight=618.26   }}
+
−
{{#set: common name=ADP ribose 1''-2''-cyclic phosphate|ADP ribose 1'',2''-phosphate|adenosine diphosphate ribose 1'',2''-cyclic phosphate|Appr>p}}
+
−
{{#set: produced by=2.7.1.160-RXN}}
+

Revision as of 15:56, 21 March 2018

Gene Tiso_gene_12835

  • right end position:
    • 2273
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 89
  • centisome position:
    • 1.3281599
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14014&oldid=37449"