Difference between revisions of "Tiso gene 7286"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11673 CPD-11673] == * smiles: ** C(O)CC1(=CNC3(=C1C=C(OC2(OC(C(=O)O)C(O)C(O)C(O)2))C=C3)) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16627 RXN-16627] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyacyl-[acyl-carrier...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16627 RXN-16627] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 3-hydroxyacyl-[acyl-carrier-protein] dehydratase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59] |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[3R-9Z-3-hydroxy-octadec-9-enoyl-ACPs]][c] '''=>''' 1 [[2E-9Z-octadeca-2-9-dienoyl-ACPs]][c] '''+''' 1 [[WATER]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a (3R,9Z)-3-hydroxy-octadec-9-enoyl-[acp][c] '''=>''' 1 a (2E,9Z)-octadeca-2,9-dienoyl-[acp][c] '''+''' 1 H2O[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_6884]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-7664]], oleate biosynthesis IV (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7664 PWY-7664] | ||
+ | ** '''10''' reactions found over '''14''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=3-hydroxyacyl-[acyl-carrier-protein] dehydratase}} | |
− | {{#set: | + | {{#set: ec number=EC-4.2.1.59}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_6884}} |
− | {{#set: | + | {{#set: in pathway=PWY-7664}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-experimental_annotation}} |
+ | {{#set: reconstruction tool=pathwaytools}} |
Revision as of 16:56, 21 March 2018
Contents
Reaction RXN-16627
- direction:
- LEFT-TO-RIGHT
- common name:
- 3-hydroxyacyl-[acyl-carrier-protein] dehydratase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 3R-9Z-3-hydroxy-octadec-9-enoyl-ACPs[c] => 1 2E-9Z-octadeca-2-9-dienoyl-ACPs[c] + 1 WATER[c]
- With common name(s):
- 1 a (3R,9Z)-3-hydroxy-octadec-9-enoyl-[acp][c] => 1 a (2E,9Z)-octadeca-2,9-dienoyl-[acp][c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_6884
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-experimental_annotation
Pathways
- PWY-7664, oleate biosynthesis IV (anaerobic): PWY-7664
- 10 reactions found over 14 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links
"3-hydroxyacyl-[acyl-carrier-protein] dehydratase" cannot be used as a page name in this wiki.