Difference between revisions of "RXN1G-182"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TYR TYR] == * smiles: ** C(C(CC1(C=CC(O)=CC=1))[N+])(=O)[O-] * inchi key: ** InChIKey=OUYCCCASQ...") |
(Created page with "Category:Gene == Gene Tiso_gene_7855 == * right end position: ** 8839 * transcription direction: ** POSITIVE * left end position: ** 7630 * centisome position: ** 46.66952...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7855 == |
− | * | + | * right end position: |
− | ** | + | ** 8839 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 7630 |
− | * | + | * centisome position: |
− | ** | + | ** 46.66952 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ACYLCOASYN-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[LINOLENOYL-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[RXN- | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[R223-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | * Reaction: [[RXN-12184]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-12978]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-13290]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-13614]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-16380]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-16389]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-16393]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-16401]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-16402]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-16415]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-16418]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-7904]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-9623]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-9644]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-9673]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN0-7238]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN0-7239]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN0-7248]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN66-469]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN66-477]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN66-480]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN66-483]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN66-484]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[TRANS-RXN0-623]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6920]] | ||
+ | * [[P221-PWY]] | ||
+ | * [[PWY-321]] | ||
+ | * [[PWY-5972]] | ||
+ | * [[PWY-5971]] | ||
+ | * [[PWY-7033]] | ||
+ | * [[PWY-5136]] | ||
+ | * [[PWY66-389]] | ||
+ | * [[PWY-7288]] | ||
+ | * [[PWY-6733]] | ||
+ | * [[PWY-7094]] | ||
+ | * [[PWY66-391]] | ||
+ | * [[FAO-PWY]] | ||
+ | * [[PWY-1121]] | ||
+ | * [[PWY-6873]] | ||
+ | * [[PWY-5147]] | ||
+ | * [[PWY-5143]] | ||
+ | * [[PWY-5885]] | ||
+ | * [[PWY-7724]] | ||
+ | * [[PWY-6001]] | ||
+ | * [[PWY-6000]] | ||
+ | * [[PWY-7049]] | ||
+ | * [[PWY66-387]] | ||
+ | * [[PWY-5989]] | ||
+ | * [[PWY-6803]] | ||
+ | * [[PWY66-388]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=8839}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=7630}} | |
− | + | {{#set: centisome position=46.66952 }} | |
− | + | {{#set: reaction associated=ACYLCOASYN-RXN|LINOLENOYL-RXN|R223-RXN|RXN-12184|RXN-12978|RXN-13290|RXN-13614|RXN-16380|RXN-16389|RXN-16393|RXN-16401|RXN-16402|RXN-16415|RXN-16418|RXN-7904|RXN-9623|RXN-9644|RXN-9673|RXN0-7238|RXN0-7239|RXN0-7248|RXN66-469|RXN66-477|RXN66-480|RXN66-483|RXN66-484|TRANS-RXN0-623}} | |
− | + | {{#set: pathway associated=PWY-6920|P221-PWY|PWY-321|PWY-5972|PWY-5971|PWY-7033|PWY-5136|PWY66-389|PWY-7288|PWY-6733|PWY-7094|PWY66-391|FAO-PWY|PWY-1121|PWY-6873|PWY-5147|PWY-5143|PWY-5885|PWY-7724|PWY-6001|PWY-6000|PWY-7049|PWY66-387|PWY-5989|PWY-6803|PWY66-388}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 16:56, 21 March 2018
Gene Tiso_gene_7855
- right end position:
- 8839
- transcription direction:
- POSITIVE
- left end position:
- 7630
- centisome position:
- 46.66952
- Synonym(s):
Reactions associated
- Reaction: ACYLCOASYN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: LINOLENOYL-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: R223-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-12184
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-12978
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-13290
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-13614
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-16380
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-16389
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-16393
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-16401
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-16402
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-16415
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-16418
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-7904
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-9623
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-9644
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-9673
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN0-7238
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN0-7239
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN0-7248
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN66-469
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN66-477
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN66-480
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN66-483
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN66-484
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: TRANS-RXN0-623
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
Pathways associated
- PWY-6920
- P221-PWY
- PWY-321
- PWY-5972
- PWY-5971
- PWY-7033
- PWY-5136
- PWY66-389
- PWY-7288
- PWY-6733
- PWY-7094
- PWY66-391
- FAO-PWY
- PWY-1121
- PWY-6873
- PWY-5147
- PWY-5143
- PWY-5885
- PWY-7724
- PWY-6001
- PWY-6000
- PWY-7049
- PWY66-387
- PWY-5989
- PWY-6803
- PWY66-388