Difference between revisions of "RXN1G-182"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TYR TYR] == * smiles: ** C(C(CC1(C=CC(O)=CC=1))[N+])(=O)[O-] * inchi key: ** InChIKey=OUYCCCASQ...")
(Created page with "Category:Gene == Gene Tiso_gene_7855 == * right end position: ** 8839 * transcription direction: ** POSITIVE * left end position: ** 7630 * centisome position: ** 46.66952...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TYR TYR] ==
+
== Gene Tiso_gene_7855 ==
−
* smiles:
+
* right end position:
−
** C(C(CC1(C=CC(O)=CC=1))[N+])(=O)[O-]
+
** 8839
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OUYCCCASQSFEME-QMMMGPOBSA-N
+
** POSITIVE
−
* common name:
+
* left end position:
−
** L-tyrosine
+
** 7630
−
* molecular weight:
+
* centisome position:
−
** 181.191    
+
** 46.66952    
 
* Synonym(s):
 
* Synonym(s):
−
** Y
 
−
** tyr
 
−
** tyrosine
 
−
** L-tyr
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[MONOPHENOL-MONOOXYGENASE-RXN]]
+
* Reaction: [[ACYLCOASYN-RXN]]
−
* [[6.3.2.25-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RME144]]
+
*** Assignment: ec-number
−
* [[TYROSINE-DECARBOXYLASE-RXN]]
+
* Reaction: [[LINOLENOYL-RXN]]
−
* [[TYROSINE--TRNA-LIGASE-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-5861]]
+
*** Assignment: ec-number
−
* [[TRANS-RXN-77]]
+
* Reaction: [[R223-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[TRANS-RXN-77]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-12184]]
−
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12978]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13290]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13614]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16380]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16389]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16393]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16401]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16402]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16415]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16418]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-7904]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9623]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9644]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9673]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-7238]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-7239]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-7248]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-469]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-477]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-480]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-483]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN66-484]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[TRANS-RXN0-623]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6920]]
 +
* [[P221-PWY]]
 +
* [[PWY-321]]
 +
* [[PWY-5972]]
 +
* [[PWY-5971]]
 +
* [[PWY-7033]]
 +
* [[PWY-5136]]
 +
* [[PWY66-389]]
 +
* [[PWY-7288]]
 +
* [[PWY-6733]]
 +
* [[PWY-7094]]
 +
* [[PWY66-391]]
 +
* [[FAO-PWY]]
 +
* [[PWY-1121]]
 +
* [[PWY-6873]]
 +
* [[PWY-5147]]
 +
* [[PWY-5143]]
 +
* [[PWY-5885]]
 +
* [[PWY-7724]]
 +
* [[PWY-6001]]
 +
* [[PWY-6000]]
 +
* [[PWY-7049]]
 +
* [[PWY66-387]]
 +
* [[PWY-5989]]
 +
* [[PWY-6803]]
 +
* [[PWY66-388]]
 
== External links  ==
 
== External links  ==
−
* CAS : 60-18-4
+
{{#set: right end position=8839}}
−
* METABOLIGHTS : MTBLC58315
+
{{#set: transcription direction=POSITIVE}}
−
* PUBCHEM:
+
{{#set: left end position=7630}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6942100 6942100]
+
{{#set: centisome position=46.66952   }}
−
* HMDB : HMDB00158
+
{{#set: reaction associated=ACYLCOASYN-RXN|LINOLENOYL-RXN|R223-RXN|RXN-12184|RXN-12978|RXN-13290|RXN-13614|RXN-16380|RXN-16389|RXN-16393|RXN-16401|RXN-16402|RXN-16415|RXN-16418|RXN-7904|RXN-9623|RXN-9644|RXN-9673|RXN0-7238|RXN0-7239|RXN0-7248|RXN66-469|RXN66-477|RXN66-480|RXN66-483|RXN66-484|TRANS-RXN0-623}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-6920|P221-PWY|PWY-321|PWY-5972|PWY-5971|PWY-7033|PWY-5136|PWY66-389|PWY-7288|PWY-6733|PWY-7094|PWY66-391|FAO-PWY|PWY-1121|PWY-6873|PWY-5147|PWY-5143|PWY-5885|PWY-7724|PWY-6001|PWY-6000|PWY-7049|PWY66-387|PWY-5989|PWY-6803|PWY66-388}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00082 C00082]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58315 58315]
+
−
* BIGG : tyr__L
+
−
{{#set: smiles=C(C(CC1(C=CC(O)=CC=1))[N+])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=OUYCCCASQSFEME-QMMMGPOBSA-N}}
+
−
{{#set: common name=L-tyrosine}}
+
−
{{#set: molecular weight=181.191   }}
+
−
{{#set: common name=Y|tyr|tyrosine|L-tyr}}
+
−
{{#set: consumed by=MONOPHENOL-MONOOXYGENASE-RXN|6.3.2.25-RXN|RME144|TYROSINE-DECARBOXYLASE-RXN|TYROSINE--TRNA-LIGASE-RXN|RXN-5861|TRANS-RXN-77}}
+
−
{{#set: produced by=TRANS-RXN-77}}
+
−
{{#set: reversible reaction associated=TYROSINE-AMINOTRANSFERASE-RXN}}
+

Revision as of 15:56, 21 March 2018

Gene Tiso_gene_7855

  • right end position:
    • 8839
  • transcription direction:
    • POSITIVE
  • left end position:
    • 7630
  • centisome position:
    • 46.66952
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN1G-182&oldid=37465"