Difference between revisions of "Tiso gene 18201"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17373 CPD-17373] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ubiquitin-activating-protein-E1-L-cys Ubiquitin-activating-protein-E1-L-cys] == * common name:...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17373 CPD-17373] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ubiquitin-activating-protein-E1-L-cys Ubiquitin-activating-protein-E1-L-cys] ==
* smiles:
+
** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O
+
* inchi key:
+
** InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L
+
 
* common name:
 
* common name:
** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate
+
** an [E1 ubiquitin-activating enzyme]-L-cysteine
* molecular weight:
+
** 728.942   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a [ubiquitin-activating enzyme E1]-L-cysteine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16121]]
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16118]]
+
* [[RXN-15563]]
 +
* [[RXN-15556]]
 +
* [[RXN-16314]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an [E1 ubiquitin-activating enzyme]-L-cysteine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819824 91819824]
+
{{#set: common name=a [ubiquitin-activating enzyme E1]-L-cysteine}}
{{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O}}
+
{{#set: consumed by=UBIQUITIN--PROTEIN-LIGASE-RXN}}
{{#set: inchi key=InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L}}
+
{{#set: produced by=RXN-15563|RXN-15556|RXN-16314}}
{{#set: common name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate}}
+
{{#set: molecular weight=728.942    }}
+
{{#set: consumed by=RXN-16121}}
+
{{#set: produced by=RXN-16118}}
+

Revision as of 16:56, 21 March 2018

Metabolite Ubiquitin-activating-protein-E1-L-cys

  • common name:
    • an [E1 ubiquitin-activating enzyme]-L-cysteine
  • Synonym(s):
    • a [ubiquitin-activating enzyme E1]-L-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an [E1 ubiquitin-activating enzyme]-L-cysteine" cannot be used as a page name in this wiki.
"a [ubiquitin-activating enzyme E1]-L-cysteine" cannot be used as a page name in this wiki.