Difference between revisions of "NICONUCADENYLYLTRAN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9923 CPD-9923] == * smiles: ** C1(=CC(O)C(C(=O)[O-])C(=C1)C(=O)CCC(=O)[O-]) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FOLYLPOLYGLUTAMATESYNTH-RXN FOLYLPOLYGLUTAMATESYNTH-RXN] == * direction: ** LEFT-TO-RIGHT * common...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FOLYLPOLYGLUTAMATESYNTH-RXN FOLYLPOLYGLUTAMATESYNTH-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** folylpolyglutamate_synthase |
− | * | + | ** bifunctional_protein |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/6.3.2.17 EC-6.3.2.17] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[GLT]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[THF-GLU-N]][c] '''=>''' 1 [[THF-GLU-N]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[Pi]][c] |
− | == | + | * With common name(s): |
+ | ** 1 L-glutamate[c] '''+''' 1 ATP[c] '''+''' 1 a tetrahydrofolate[c] '''=>''' 1 a tetrahydrofolate[c] '''+''' 1 ADP[c] '''+''' 1 phosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_15942]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_92]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-2161]], folate polyglutamylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2161 PWY-2161] | ||
+ | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04241 R04241] |
− | * | + | * UNIPROT: |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P15925 P15925] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9JVC6 Q9JVC6] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P43775 P43775] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PNK6 Q9PNK6] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9CGE0 Q9CGE0] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/Q50990 Q50990] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P48760 P48760] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P08192 P08192] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O13492 O13492] |
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=folylpolyglutamate_synthase}} | ||
+ | {{#set: common name=bifunctional_protein}} | ||
+ | {{#set: ec number=EC-6.3.2.17}} | ||
+ | {{#set: gene associated=Tiso_gene_15942|Tiso_gene_92}} | ||
+ | {{#set: in pathway=PWY-2161}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 15:56, 21 March 2018
Contents
Reaction FOLYLPOLYGLUTAMATESYNTH-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- folylpolyglutamate_synthase
- bifunctional_protein
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 L-glutamate[c] + 1 ATP[c] + 1 a tetrahydrofolate[c] => 1 a tetrahydrofolate[c] + 1 ADP[c] + 1 phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_15942
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_92
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links