Difference between revisions of "Tiso gene 6736"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=G5-pppR-mRNAs G5-pppR-mRNAs] == * common name: ** a 5'-(5'-triphosphoguanosine)-purine-[mRNA] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE] == * smiles: *...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE] == |
+ | * smiles: | ||
+ | ** C(O)C2(=NC1(C(=O)NC(N)=NC=1NC2)) | ||
* common name: | * common name: | ||
− | ** | + | ** 6-(hydroxymethyl)-7,8-dihydropterin |
+ | * inchi key: | ||
+ | ** InChIKey=CQQNNQTXUGLUEV-UHFFFAOYSA-N | ||
+ | * molecular weight: | ||
+ | ** 195.18 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2-amino-6-(hydroxymethyl)-7,8-dihydropteridin-4(3H)-one |
− | ** | + | ** 2-amino-6-(hydroxymethyl)-7,8-dihydropteridin-4-one |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[H2PTERIDINEPYROPHOSPHOKIN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-10857]] | ||
+ | * [[RXN-14226]] | ||
+ | * [[H2NEOPTERINALDOL-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * DRUGBANK : DB02119 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=218 218] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01300 C01300] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.213.html 213] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=44841 44841] | ||
+ | * BIGG : 6hmhpt | ||
+ | {{#set: smiles=C(O)C2(=NC1(C(=O)NC(N)=NC=1NC2))}} | ||
+ | {{#set: common name=6-(hydroxymethyl)-7,8-dihydropterin}} | ||
+ | {{#set: inchi key=InChIKey=CQQNNQTXUGLUEV-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=195.18 }} | ||
+ | {{#set: common name=2-amino-6-(hydroxymethyl)-7,8-dihydropteridin-4(3H)-one|2-amino-6-(hydroxymethyl)-7,8-dihydropteridin-4-one}} | ||
+ | {{#set: consumed by=H2PTERIDINEPYROPHOSPHOKIN-RXN}} | ||
+ | {{#set: reversible reaction associated=RXN-10857|RXN-14226|H2NEOPTERINALDOL-RXN}} |
Revision as of 15:56, 21 March 2018
Contents
Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE
- smiles:
- C(O)C2(=NC1(C(=O)NC(N)=NC=1NC2))
- common name:
- 6-(hydroxymethyl)-7,8-dihydropterin
- inchi key:
- InChIKey=CQQNNQTXUGLUEV-UHFFFAOYSA-N
- molecular weight:
- 195.18
- Synonym(s):
- 2-amino-6-(hydroxymethyl)-7,8-dihydropteridin-4(3H)-one
- 2-amino-6-(hydroxymethyl)-7,8-dihydropteridin-4-one
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links