Difference between revisions of "CPD-11527"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10825 CPD-10825] == * smiles: ** CC1(=C(OC(C1)=O)CC([O-])=O) * inchi key: ** InChIKey=DAJDH...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17847 RXN-17847] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF ** leucyl_phenylalanyl-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17847 RXN-17847] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** ORF |
| − | * | + | ** leucyl_phenylalanyl-trna--protein_transferase |
| − | ** | + | ** leucyl_phenylalanyl-trna--protein |
| + | * ec number: | ||
| + | ** [http://enzyme.expasy.org/EC/2.3.2.6 EC-2.3.2.6] | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[Protein-N-terminal-L-Arginine]][c] '''+''' 1 [[Charged-PHE-tRNAs]][c] '''=>''' 1 [[PHE-tRNAs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[L-phenylalanyl-L-arginyl-Protein]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 an N-terminal arginyl-[protein][c] '''+''' 1 an L-phenylalanyl-[tRNAphe][c] '''=>''' 1 a tRNAphe[c] '''+''' 1 H+[c] '''+''' 1 L-phenylalanyl-L-arginyl-[protein][c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_8540]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_13698]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | * Gene: [[Tiso_gene_2584]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=ORF}} | |
| − | {{#set: | + | {{#set: common name=leucyl_phenylalanyl-trna--protein_transferase}} |
| − | {{#set: | + | {{#set: common name=leucyl_phenylalanyl-trna--protein}} |
| − | {{#set: common name= | + | {{#set: ec number=EC-2.3.2.6}} |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_8540|Tiso_gene_13698|Tiso_gene_2584}} |
| − | {{#set: | + | {{#set: in pathway=}} |
| + | {{#set: reconstruction category=annotation}} | ||
| + | {{#set: reconstruction source=annotation-in-silico_annotation}} | ||
| + | {{#set: reconstruction tool=pathwaytools}} | ||
Revision as of 15:56, 21 March 2018
Contents
Reaction RXN-17847
- direction:
- LEFT-TO-RIGHT
- common name:
- ORF
- leucyl_phenylalanyl-trna--protein_transferase
- leucyl_phenylalanyl-trna--protein
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Protein-N-terminal-L-Arginine[c] + 1 Charged-PHE-tRNAs[c] => 1 PHE-tRNAs[c] + 1 PROTON[c] + 1 L-phenylalanyl-L-arginyl-Protein[c]
- With common name(s):
- 1 an N-terminal arginyl-[protein][c] + 1 an L-phenylalanyl-[tRNAphe][c] => 1 a tRNAphe[c] + 1 H+[c] + 1 L-phenylalanyl-L-arginyl-[protein][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_8540
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_13698
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_2584
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
