Difference between revisions of "Tiso gene 9503"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTO-14-FURANOSE UDP-D-GALACTO-14-FURANOSE] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3DJ-118 RXN3DJ-118] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * Wit...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTO-14-FURANOSE UDP-D-GALACTO-14-FURANOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN3DJ-118 RXN3DJ-118] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])OP(=O)([O-])OC1(O[CH](C(O)CO)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZQLQOXLUCGXKHS-SIAUPFDVSA-L
+
−
* common name:
+
−
** UDP-α-D-galactofuranose
+
−
* molecular weight:
+
−
** 564.289   
+
 
* Synonym(s):
 
* Synonym(s):
−
** UDP-Galf
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[CPD-13612]][c] '''+''' 1 [[Long-Chain-Acyl-CoAs]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD3DJ-82]][c]
−
* [[GALPMUT-RXN]]
+
* With common name(s):
 +
** 1 D-erythro-sphinganine[c] '''+''' 1 a long-chain acyl-CoA[c] '''=>''' 1 coenzyme A[c] '''+''' 1 H+[c] '''+''' 1 a dihydroceramide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY3DJ-12]], ceramide de novo biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-12 PWY3DJ-12]
 +
** '''4''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244316 25244316]
+
{{#set: in pathway=PWY3DJ-12}}
−
* CHEBI:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66915 66915]
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
* BIGG : udpgalfur
+
{{#set: reconstruction tool=pathwaytools}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C03733 C03733]
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OC1(O[CH](C(O)CO)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))}}
+
−
{{#set: inchi key=InChIKey=ZQLQOXLUCGXKHS-SIAUPFDVSA-L}}
+
−
{{#set: common name=UDP-α-D-galactofuranose}}
+
−
{{#set: molecular weight=564.289    }}
+
−
{{#set: common name=UDP-Galf}}
+
−
{{#set: reversible reaction associated=GALPMUT-RXN}}
+

Revision as of 15:57, 21 March 2018

Reaction RXN3DJ-118

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY3DJ-12, ceramide de novo biosynthesis: PWY3DJ-12
    • 4 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9503&oldid=37567"