Difference between revisions of "ETHANOLAMINE-KINASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-cis-D9-21-C40-3-ACPs trans-D2-cis-cis-D9-21-C40-3-ACPs] == * common name: ** a tra...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] == * smiles: ** C[S+](CCC([N+])C(=O)[O-])C * common name: ** S-methyl-L-methio...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=trans-D2-cis-cis-D9-21-C40-3-ACPs trans-D2-cis-cis-D9-21-C40-3-ACPs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-397 CPD-397] ==
 +
* smiles:
 +
** C[S+](CCC([N+])C(=O)[O-])C
 
* common name:
 
* common name:
** a trans-delta2-cis,cis-9,21-C40:3-[acp]
+
** S-methyl-L-methionine
 +
* inchi key:
 +
** InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O
 +
* molecular weight:
 +
** 164.242   
 
* Synonym(s):
 
* Synonym(s):
** a trans-delta2-cis,cis-9,21-C40:3-[acyl-carrier-protein]
+
** S-methylmethionine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1G-509]]
+
* [[MMUM-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a trans-delta2-cis,cis-9,21-C40:3-[acp]}}
+
* PUBCHEM:
{{#set: common name=a trans-delta2-cis,cis-9,21-C40:3-[acyl-carrier-protein]}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098638 7098638]
{{#set: consumed by=RXN1G-509}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58252 58252]
 +
* BIGG : mmet
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03172 C03172]
 +
{{#set: smiles=C[S+](CCC([N+])C(=O)[O-])C}}
 +
{{#set: common name=S-methyl-L-methionine}}
 +
{{#set: inchi key=InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O}}
 +
{{#set: molecular weight=164.242    }}
 +
{{#set: common name=S-methylmethionine}}
 +
{{#set: consumed by=MMUM-RXN}}

Revision as of 16:57, 21 March 2018

Metabolite CPD-397

  • smiles:
    • C[S+](CCC([N+])C(=O)[O-])C
  • common name:
    • S-methyl-L-methionine
  • inchi key:
    • InChIKey=YDBYJHTYSHBBAU-YFKPBYRVSA-O
  • molecular weight:
    • 164.242
  • Synonym(s):
    • S-methylmethionine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C[S+](CCC([N+])C(=O)[O-])C" cannot be used as a page name in this wiki.