Difference between revisions of "RXN-9654"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Aryl-sulfates Aryl-sulfates] == * common name: ** an aryl sulfate * Synonym(s): == Reaction(s)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15900 CPD-15900] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(C(O)CCCC1=O))COP(=O)(OP...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15900 CPD-15900] == |
| + | * smiles: | ||
| + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(C(O)CCCC1=O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-] | ||
* common name: | * common name: | ||
| − | ** | + | ** 2-hydroxy-6-oxocyclohexane-1-carbonyl-CoA |
| + | * inchi key: | ||
| + | ** InChIKey=XUJOIUADEGVEIA-SOAMHPODSA-J | ||
| + | * molecular weight: | ||
| + | ** 903.641 | ||
* Synonym(s): | * Synonym(s): | ||
| Line 8: | Line 14: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-15013]] |
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: reversible reaction associated= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551544 72551544] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76527 76527] | ||
| + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(C(O)CCCC1=O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}} | ||
| + | {{#set: common name=2-hydroxy-6-oxocyclohexane-1-carbonyl-CoA}} | ||
| + | {{#set: inchi key=InChIKey=XUJOIUADEGVEIA-SOAMHPODSA-J}} | ||
| + | {{#set: molecular weight=903.641 }} | ||
| + | {{#set: reversible reaction associated=RXN-15013}} | ||
Revision as of 15:57, 21 March 2018
Contents
Metabolite CPD-15900
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(C(O)CCCC1=O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
- common name:
- 2-hydroxy-6-oxocyclohexane-1-carbonyl-CoA
- inchi key:
- InChIKey=XUJOIUADEGVEIA-SOAMHPODSA-J
- molecular weight:
- 903.641
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C1(C(O)CCCC1=O))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.
