Difference between revisions of "Trans-D2-cis-D15-gheddoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14604 CPD-14604] == * smiles: ** CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)...")
(Created page with "Category:Gene == Gene Tiso_gene_12131 == * right end position: ** 3807 * transcription direction: ** NEGATIVE * left end position: ** 57 * centisome position: ** 0.7842597...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14604 CPD-14604] ==
+
== Gene Tiso_gene_12131 ==
−
* smiles:
+
* right end position:
−
** CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC)
+
** 3807
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BYFGTSAYQQIUCN-HGIHDBQLSA-L
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** mycophenolic acid phenolic glucuronide
+
** 57
−
* molecular weight:
+
* centisome position:
−
** 494.451    
+
** 0.78425974    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.5.1.98-RXN]]
−
* [[RXN-13608]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3807}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657160 90657160]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC(CCC([O-])=O)=CCC2(=C(C(C)=C3(COC(=O)C(=C(OC1(C(O)C(C(O)C(C([O-])=O)O1)O))2)3))OC)}}
+
{{#set: left end position=57}}
−
{{#set: inchi key=InChIKey=BYFGTSAYQQIUCN-HGIHDBQLSA-L}}
+
{{#set: centisome position=0.78425974   }}
−
{{#set: common name=mycophenolic acid phenolic glucuronide}}
+
{{#set: reaction associated=3.5.1.98-RXN}}
−
{{#set: molecular weight=494.451   }}
+
−
{{#set: produced by=RXN-13608}}
+

Revision as of 16:57, 21 March 2018

Gene Tiso_gene_12131

  • right end position:
    • 3807
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 57
  • centisome position:
    • 0.78425974
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Trans-D2-cis-D15-gheddoyl-ACPs&oldid=37651"