Difference between revisions of "RXN-7838"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-520 CPD-520] == * smiles: ** C1(C=C(O)C(O)=CC=1C2(OC3(=C(C(=O)C=2[O-])C(O)=CC(O)=C3))) * in...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-D21-39-oxo-40-Me-C59-1-ACPs cis-D21-39-oxo-40-Me-C59-1-ACPs] == * common name: ** a cis-del...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-D21-39-oxo-40-Me-C59-1-ACPs cis-D21-39-oxo-40-Me-C59-1-ACPs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a cis-delta21-39-oxo-40-methyl-C59:1-[acp] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN1G-3641]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a cis-delta21-39-oxo-40-methyl-C59:1-[acp]}} | |
| − | + | {{#set: consumed by=RXN1G-3641}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Revision as of 15:58, 21 March 2018
Contents
Metabolite cis-D21-39-oxo-40-Me-C59-1-ACPs
- common name:
- a cis-delta21-39-oxo-40-methyl-C59:1-[acp]
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a cis-delta21-39-oxo-40-methyl-C59:1-[acp" cannot be used as a page name in this wiki.
