Difference between revisions of "Tiso gene 10753"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-RIBULOSE-5-P L-RIBULOSE-5-P] == * smiles: ** C(OP(=O)([O-])[O-])C(O)C(O)C(=O)CO * inchi key:...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13323 RXN-13323] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13323 RXN-13323] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.5.1.32 EC-2.5.1.32] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 2 [[CPD0-1028]][c] '''<=>''' 1 [[CPD-12321]][c] '''+''' 2 [[PPI]][c] |
− | == | + | * With common name(s): |
+ | ** 2 2-cis,6-trans,10-trans-geranylgeranyl diphosphate[c] '''<=>''' 1 15-cis-phytoene[c] '''+''' 2 diphosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_15914]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=34478 34478] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | * LIGAND- | + | ** [http://www.genome.jp/dbget-bin/www_bget?R10177 R10177] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: direction=REVERSIBLE}} |
− | + | {{#set: ec number=EC-2.5.1.32}} | |
− | + | {{#set: gene associated=Tiso_gene_15914}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 15:58, 21 March 2018
Contents
Reaction RXN-13323
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 2 2-cis,6-trans,10-trans-geranylgeranyl diphosphate[c] <=> 1 15-cis-phytoene[c] + 2 diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_15914
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links