Difference between revisions of "CPD1F-137"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] == * smiles: ** CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPATE 3-KETO-ADIPATE] == * smiles: ** C(=O)([O-])CC(=O)CCC(=O)[O-] * common name: ** 3...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPATE 3-KETO-ADIPATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(=O)([O-])CC(=O)CCC(=O)[O-] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** 3- | + | ** 3-oxoadipate |
| + | * inchi key: | ||
| + | ** InChIKey=RTGHRDFWYQHVFW-UHFFFAOYSA-L | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 158.11 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** β-ketoadipate |
| + | ** 3-ketoadipate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3-OXOADIPATE-ENOL-LACTONASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| + | * UM-BBD-CPD : c0100 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459800 5459800] |
| − | {{#set: smiles= | + | * HMDB : HMDB00398 |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00846 C00846] |
| − | {{#set: molecular weight= | + | * CHEMSPIDER: |
| − | {{#set: common name=3- | + | ** [http://www.chemspider.com/Chemical-Structure.4573571.html 4573571] |
| − | {{#set: | + | * CHEBI: |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15775 15775] | |
| + | {{#set: smiles=C(=O)([O-])CC(=O)CCC(=O)[O-]}} | ||
| + | {{#set: common name=3-oxoadipate}} | ||
| + | {{#set: inchi key=InChIKey=RTGHRDFWYQHVFW-UHFFFAOYSA-L}} | ||
| + | {{#set: molecular weight=158.11 }} | ||
| + | {{#set: common name=β-ketoadipate|3-ketoadipate}} | ||
| + | {{#set: produced by=3-OXOADIPATE-ENOL-LACTONASE-RXN}} | ||
Revision as of 15:58, 21 March 2018
Contents
Metabolite 3-KETO-ADIPATE
- smiles:
- C(=O)([O-])CC(=O)CCC(=O)[O-]
- common name:
- 3-oxoadipate
- inchi key:
- InChIKey=RTGHRDFWYQHVFW-UHFFFAOYSA-L
- molecular weight:
- 158.11
- Synonym(s):
- β-ketoadipate
- 3-ketoadipate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- UM-BBD-CPD : c0100
- PUBCHEM:
- HMDB : HMDB00398
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
"C(=O)([O-])CC(=O)CCC(=O)[O-" cannot be used as a page name in this wiki.
