Difference between revisions of "Tiso gene 18270"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == * smiles: ** C1(NC=NC=1CC(C(=O)[O-])[N+]) * inchi key: ** InChIKey=HNDVDQJCIGZPNO-Y...") |
(Created page with "Category:Gene == Gene Tiso_gene_12326 == * Synonym(s): == Reactions associated == * Reaction: QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN ** Source: orthology-esiliculosu...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12326 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]] |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | * [[ | + | * Reaction: [[RXN0-1321]] |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | + | == Pathways associated == | |
− | * [[ | + | * [[PWY-6700]] |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN|RXN0-1321}} | |
− | + | {{#set: pathway associated=PWY-6700}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 16:58, 21 March 2018
Gene Tiso_gene_12326
- Synonym(s):
Reactions associated
- Reaction: QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN
- Source: orthology-esiliculosus
- Reaction: RXN0-1321
- Source: orthology-esiliculosus