Difference between revisions of "Tiso gene 8816"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2750 CPD-2750] == * smiles: ** C1(=O)(C(O)C[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIK...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-20 RXN1F-20] == * direction: ** LEFT-TO-RIGHT * common name: ** Magnesium chelatase, H subuni...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-20 RXN1F-20] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Magnesium chelatase, H subunit |
− | * | + | ** h_subunit_of_mg_chelatase |
− | ** | + | ** magnesium_chelatase |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/6.6.1.1 EC-6.6.1.1] | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[WATER]][c] '''+''' 1 [[MG+2]][c] '''+''' 1 [[PROTOPORPHYRIN_IX]][c] '''+''' 1 [[ATP]][c] '''=>''' 3 [[PROTON]][c] '''+''' 1 [[MG-PROTOPORPHYRIN]][c] '''+''' 1 [[ADP]][c] '''+''' 1 [[Pi]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 H2O[c] '''+''' 1 Mg2+[c] '''+''' 1 protoporphyrin IX[c] '''+''' 1 ATP[c] '''=>''' 3 H+[c] '''+''' 1 Mg-protoporphyrin[c] '''+''' 1 ADP[c] '''+''' 1 phosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_11960]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_5993]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_9870]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5531]], 3,8-divinyl-chlorophyllide a biosynthesis II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5531 PWY-5531] | ||
+ | ** '''4''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[CHLOROPHYLL-SYN]], 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent): [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-SYN CHLOROPHYLL-SYN] | ||
+ | ** '''9''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[PWY-7159]], 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7159 PWY-7159] | ||
+ | ** '''8''' reactions found over '''9''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13961 13961] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03877 R03877] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=Magnesium chelatase, H subunit}} | |
− | + | {{#set: common name=h_subunit_of_mg_chelatase}} | |
− | + | {{#set: common name=magnesium_chelatase}} | |
− | {{#set: | + | {{#set: ec number=EC-6.6.1.1}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_11960|Tiso_gene_5993|Tiso_gene_9870}} |
− | {{#set: | + | {{#set: in pathway=PWY-5531|CHLOROPHYLL-SYN|PWY-7159}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|manual|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-experimental_annotation|orthology-athaliana|annotation-in-silico_annotation|manual-primary_network|orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 16:58, 21 March 2018
Contents
Reaction RXN1F-20
- direction:
- LEFT-TO-RIGHT
- common name:
- Magnesium chelatase, H subunit
- h_subunit_of_mg_chelatase
- magnesium_chelatase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 MG+2[c] + 1 PROTOPORPHYRIN_IX[c] + 1 ATP[c] => 3 PROTON[c] + 1 MG-PROTOPORPHYRIN[c] + 1 ADP[c] + 1 Pi[c]
- With common name(s):
- 1 H2O[c] + 1 Mg2+[c] + 1 protoporphyrin IX[c] + 1 ATP[c] => 3 H+[c] + 1 Mg-protoporphyrin[c] + 1 ADP[c] + 1 phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_11960
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_5993
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_9870
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
- PWY-5531, 3,8-divinyl-chlorophyllide a biosynthesis II (anaerobic): PWY-5531
- 4 reactions found over 9 reactions in the full pathway
- CHLOROPHYLL-SYN, 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent): CHLOROPHYLL-SYN
- 9 reactions found over 9 reactions in the full pathway
- PWY-7159, 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent): PWY-7159
- 8 reactions found over 9 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
- Category: manual
- Source: manual-primary_network
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links