Difference between revisions of "RNA-Holder"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMYL-GLX-TRNAS GLUTAMYL-GLX-TRNAS] == * common name: ** an L-glutamyl-[tRNAGlx] * Synonym(s...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17701 CPD-17701] == * smiles: ** C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17701 CPD-17701] == |
+ | * smiles: | ||
+ | ** C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([O-])(=O)=O)C(O)C=C(C([O-])=O)O2)) | ||
* common name: | * common name: | ||
− | ** | + | ** 4-deoxy-2-O-sulfo-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate |
+ | * inchi key: | ||
+ | ** InChIKey=LRPGJWKAYQRIAQ-NODFLXBDSA-J | ||
+ | * molecular weight: | ||
+ | ** 573.426 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-16483]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820214 91820214] |
+ | {{#set: smiles=C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([O-])(=O)=O)C(O)C=C(C([O-])=O)O2))}} | ||
+ | {{#set: common name=4-deoxy-2-O-sulfo-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate}} | ||
+ | {{#set: inchi key=InChIKey=LRPGJWKAYQRIAQ-NODFLXBDSA-J}} | ||
+ | {{#set: molecular weight=573.426 }} | ||
+ | {{#set: consumed by=RXN-16483}} |
Revision as of 15:58, 21 March 2018
Contents
Metabolite CPD-17701
- smiles:
- C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([O-])(=O)=O)C(O)C=C(C([O-])=O)O2))
- common name:
- 4-deoxy-2-O-sulfo-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate
- inchi key:
- InChIKey=LRPGJWKAYQRIAQ-NODFLXBDSA-J
- molecular weight:
- 573.426
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([O-])(=O)=O)C(O)C=C(C([O-])=O)O2))" cannot be used as a page name in this wiki.