Difference between revisions of "RNA-Holder"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMYL-GLX-TRNAS GLUTAMYL-GLX-TRNAS] == * common name: ** an L-glutamyl-[tRNAGlx] * Synonym(s...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17701 CPD-17701] == * smiles: ** C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTAMYL-GLX-TRNAS GLUTAMYL-GLX-TRNAS] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17701 CPD-17701] ==
 +
* smiles:
 +
** C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([O-])(=O)=O)C(O)C=C(C([O-])=O)O2))
 
* common name:
 
* common name:
** an L-glutamyl-[tRNAGlx]
+
** 4-deoxy-2-O-sulfo-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate
 +
* inchi key:
 +
** InChIKey=LRPGJWKAYQRIAQ-NODFLXBDSA-J
 +
* molecular weight:
 +
** 573.426   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16483]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[6.1.1.24-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=an L-glutamyl-[tRNAGlx]}}
+
* PUBCHEM:
{{#set: produced by=6.1.1.24-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820214 91820214]
 +
{{#set: smiles=C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([O-])(=O)=O)C(O)C=C(C([O-])=O)O2))}}
 +
{{#set: common name=4-deoxy-2-O-sulfo-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate}}
 +
{{#set: inchi key=InChIKey=LRPGJWKAYQRIAQ-NODFLXBDSA-J}}
 +
{{#set: molecular weight=573.426    }}
 +
{{#set: consumed by=RXN-16483}}

Revision as of 15:58, 21 March 2018

Metabolite CPD-17701

  • smiles:
    • C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([O-])(=O)=O)C(O)C=C(C([O-])=O)O2))
  • common name:
    • 4-deoxy-2-O-sulfo-β-L-erythro-hex-4-enopyranuronosyl-(1,4)-D-N-sulfoglucosamine 6-O-sulfate
  • inchi key:
    • InChIKey=LRPGJWKAYQRIAQ-NODFLXBDSA-J
  • molecular weight:
    • 573.426
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OS(=O)(=O)[O-])C1(OC(O)C(NS(=O)(=O)[O-])C(O)C1OC2(C(OS([O-])(=O)=O)C(O)C=C(C([O-])=O)O2))" cannot be used as a page name in this wiki.