Difference between revisions of "RXN-11569"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANTHINE HYPOXANTHINE] == * smiles: ** C1(NC2(=C(N=1)N=CNC(=O)2)) * inchi key: ** InChIKey=...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13600 RXN-13600] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13600 RXN-13600] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/4.1.2 EC-4.1.2] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[CPD-1103]][c] '''=>''' 1 [[HCN]][c] '''+''' 1 [[4-HYDROXYBENZALDEHYDE]][c] '''+''' 1 [[Glucopyranose]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 H2O[c] '''+''' 1 taxiphyllin[c] '''=>''' 1 hydrogen cyanide[c] '''+''' 1 4-hydroxybenzaldehyde[c] '''+''' 1 D-glucopyranose[c] |
| − | == | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_2344]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | * Gene: [[Tiso_gene_6497]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | * Gene: [[Tiso_gene_10001]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | * Gene: [[Tiso_gene_2843]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-7089]], taxiphyllin bioactivation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7089 PWY-7089] | ||
| + | ** '''1''' reactions found over '''1''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-4.1.2}} | |
| − | + | {{#set: gene associated=Tiso_gene_2344|Tiso_gene_6497|Tiso_gene_10001|Tiso_gene_2843}} | |
| − | + | {{#set: in pathway=PWY-7089}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:58, 21 March 2018
Contents
Reaction RXN-13600
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 CPD-1103[c] => 1 HCN[c] + 1 4-HYDROXYBENZALDEHYDE[c] + 1 Glucopyranose[c]
- With common name(s):
- 1 H2O[c] + 1 taxiphyllin[c] => 1 hydrogen cyanide[c] + 1 4-hydroxybenzaldehyde[c] + 1 D-glucopyranose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_2344
- Source: orthology-esiliculosus
- Gene: Tiso_gene_6497
- Source: orthology-esiliculosus
- Gene: Tiso_gene_10001
- Source: orthology-esiliculosus
- Gene: Tiso_gene_2843
- Source: orthology-esiliculosus
Pathways
- PWY-7089, taxiphyllin bioactivation: PWY-7089
- 1 reactions found over 1 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
