Difference between revisions of "L-ALPHA-ALANINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-PHOSPHO-L-HOMOSERINE O-PHOSPHO-L-HOMOSERINE] == * smiles: ** C(COP([O-])(=O)[O-])C([N+])C([O-...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12244 RXN-12244] == * direction: ** LEFT-TO-RIGHT * common name: ** 15-cis-phytoene desaturase...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-PHOSPHO-L-HOMOSERINE O-PHOSPHO-L-HOMOSERINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12244 RXN-12244] ==
−
* smiles:
+
* direction:
−
** C(COP([O-])(=O)[O-])C([N+])C([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=FXDNYOANAXWZHG-VKHMYHEASA-L
+
 
* common name:
 
* common name:
−
** O-phospho-L-homoserine
+
** 15-cis-phytoene desaturase
−
* molecular weight:
+
−
** 197.084   
+
 
* Synonym(s):
 
* Synonym(s):
−
** o-phosphohomoserine
+
** phytoene desaturase (ambiguous)
 +
** PDS
 +
** plant-type phytoene desaturase
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12728]]
+
* With identifiers:
−
* [[THRESYN-RXN]]
+
** 1 [[PLASTOQUINONE]][c] '''+''' 1 [[CPD-13171]][c] '''=>''' 1 [[Plastoquinols]][c] '''+''' 1 [[CPD-7535]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[HOMOSERKIN-RXN]]
+
** 1 a plastoquinone[c] '''+''' 1 15,9'-di-cis-phytofluene[c] '''=>''' 1 a plastoquinol[c] '''+''' 1 9,15,9'-tri-cis-ζ-carotene[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-6475]], trans-lycopene biosynthesis II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6475 PWY-6475]
 +
** '''8''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-reactions_pwy-6475_tiso_add]]
 +
*** Comment: [[reaction added to complete pwy-6475]]
 
== External links  ==
 
== External links  ==
−
* BIGG : phom
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30198 30198]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878406 46878406]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* HMDB : HMDB03484
+
{{#set: common name=15-cis-phytoene desaturase}}
−
* LIGAND-CPD:
+
{{#set: common name=phytoene desaturase (ambiguous)|PDS|plant-type phytoene desaturase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01102 C01102]
+
{{#set: in pathway=PWY-6475}}
−
* CHEBI:
+
{{#set: reconstruction category=manual}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57590 57590]
+
{{#set: reconstruction source=manual-reactions_pwy-6475_tiso_add}}
−
* METABOLIGHTS : MTBLC57590
+
{{#set: reconstruction comment=reaction added to complete pwy-6475}}
−
{{#set: smiles=C(COP([O-])(=O)[O-])C([N+])C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=FXDNYOANAXWZHG-VKHMYHEASA-L}}
+
−
{{#set: common name=O-phospho-L-homoserine}}
+
−
{{#set: molecular weight=197.084    }}
+
−
{{#set: common name=o-phosphohomoserine}}
+
−
{{#set: consumed by=RXN-12728|THRESYN-RXN}}
+
−
{{#set: produced by=HOMOSERKIN-RXN}}
+

Revision as of 15:59, 21 March 2018

Reaction RXN-12244

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 15-cis-phytoene desaturase
  • Synonym(s):
    • phytoene desaturase (ambiguous)
    • PDS
    • plant-type phytoene desaturase

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a plastoquinone[c] + 1 15,9'-di-cis-phytofluene[c] => 1 a plastoquinol[c] + 1 9,15,9'-tri-cis-ζ-carotene[c]

Genes associated with this reaction

Pathways

  • PWY-6475, trans-lycopene biosynthesis II (plants): PWY-6475
    • 8 reactions found over 8 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=L-ALPHA-ALANINE&oldid=37846"