Difference between revisions of "METHYLENE-THF"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15091 RXN-15091] == * direction: ** LEFT-TO-RIGHT * common name: ** diacylglycerol kinase * ec...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * smiles: ** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O * common name:...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15091 RXN-15091] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
 
* common name:
 
* common name:
−
** diacylglycerol kinase
+
** salicyl-6-hydroxy-2-cyclohexene-on-oyl
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.7.1.174 EC-2.7.1.174]
+
** InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
 +
* molecular weight:
 +
** 262.262   
 
* Synonym(s):
 
* Synonym(s):
 +
** salicyl-HCH
 +
** 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
 +
** acylsaligenin
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-12252]]
−
** 1 [[CTP]][c] '''+''' 1 [[CPD0-1812]][c] '''=>''' 1 [[CDP]][c] '''+''' 1 [[L-1-LYSOPHOSPHATIDATE]][c] '''+''' 1 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 CTP[c] '''+''' 1 2-oleoylglycerol[c] '''=>''' 1 CDP[c] '''+''' 1 1-oleyl-2-lyso-phosphatidate[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7420]], monoacylglycerol metabolism (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7420 PWY-7420]
+
−
** '''4''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 529507-98-0
−
{{#set: common name=diacylglycerol kinase}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.7.1.174}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14731723 14731723]
−
{{#set: in pathway=PWY-7420}}
+
{{#set: smiles=C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=salicyl-6-hydroxy-2-cyclohexene-on-oyl}}
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
{{#set: inchi key=InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=262.262    }}
 +
{{#set: common name=salicyl-HCH|2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester|acylsaligenin}}
 +
{{#set: consumed by=RXN-12252}}

Revision as of 15:59, 21 March 2018

Metabolite CPD-13174

  • smiles:
    • C(C1(O)(C(=O)CCC=C1))(OCC2(C(O)=CC=CC=2))=O
  • common name:
    • salicyl-6-hydroxy-2-cyclohexene-on-oyl
  • inchi key:
    • InChIKey=WYYMYYOXCOEMCU-UHFFFAOYSA-N
  • molecular weight:
    • 262.262
  • Synonym(s):
    • salicyl-HCH
    • 2-cyclohexene-1-carboxylic acid, 1-hydroxy-6-oxo-, (2-hydroxyphenyl)methyl ester
    • acylsaligenin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=METHYLENE-THF&oldid=37923"