Difference between revisions of "COPROPORPHYRINOGEN III"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_11396 == * left end position: ** 6938 * transcription direction: ** POSITIVE * right end position: ** 7788 * centisome position: ** 88.8120...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-3-HYDROXYBUTANOYL-COA S-3-HYDROXYBUTANOYL-COA] == * smiles: ** CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-3-HYDROXYBUTANOYL-COA S-3-HYDROXYBUTANOYL-COA] == |
− | * | + | * smiles: |
− | ** | + | ** CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O |
− | * | + | * common name: |
− | ** | + | ** (S)-3-hydroxybutanoyl-CoA |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=QHHKKMYHDBRONY-VKBDFPRVSA-J |
− | * | + | * molecular weight: |
− | ** | + | ** 849.593 |
* Synonym(s): | * Synonym(s): | ||
+ | ** L-3-hydroxybutyryl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[HBCO]] |
− | ** | + | == Reaction(s) known to produce the compound == |
− | *** | + | * [[3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
+ | * [[HBCHLm]] | ||
+ | * [[RXN-11667]] | ||
+ | * [[HBCHL]] | ||
+ | * [[HBCO_nadp]] | ||
+ | * [[RXN-11662]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266553 45266553] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57316 57316] |
− | {{#set: | + | * BIGG : 3hbcoa |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01144 C01144] | ||
+ | {{#set: smiles=CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}} | ||
+ | {{#set: common name=(S)-3-hydroxybutanoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=QHHKKMYHDBRONY-VKBDFPRVSA-J}} | ||
+ | {{#set: molecular weight=849.593 }} | ||
+ | {{#set: common name=L-3-hydroxybutyryl-CoA}} | ||
+ | {{#set: consumed by=HBCO}} | ||
+ | {{#set: produced by=3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN}} | ||
+ | {{#set: reversible reaction associated=HBCHLm|RXN-11667|HBCHL|HBCO_nadp|RXN-11662}} |
Revision as of 17:00, 21 March 2018
Contents
Metabolite S-3-HYDROXYBUTANOYL-COA
- smiles:
- CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
- common name:
- (S)-3-hydroxybutanoyl-CoA
- inchi key:
- InChIKey=QHHKKMYHDBRONY-VKBDFPRVSA-J
- molecular weight:
- 849.593
- Synonym(s):
- L-3-hydroxybutyryl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O" cannot be used as a page name in this wiki.