Difference between revisions of "KDO2-LIPID-A"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_3651 == * left end position: ** 2045 * transcription direction: ** NEGATIVE * right end position: ** 9060 * centisome position: ** 12.58539...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-] * common name: ** doc...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_3651 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] ==
−
* left end position:
+
* smiles:
−
** 2045
+
** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-]
−
* transcription direction:
+
* common name:
−
** NEGATIVE
+
** docosahexaenoate
−
* right end position:
+
* inchi key:
−
** 9060
+
** InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M
−
* centisome position:
+
* molecular weight:
−
** 12.58539    
+
** 327.486    
 
* Synonym(s):
 
* Synonym(s):
 +
** docosahexaenoic acid
 +
** DHA
 +
** all-cis-docosa-4,7,10,13,16,19-hexaenoate
 +
** (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate
 +
** (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-16138]]
−
***ec-number
+
* [[RXN-16017]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 +
* [[RXN-16063]]
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2045}}
+
* LIPID_MAPS : LMFA01030185
−
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
−
{{#set: right end position=9060}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40486925 40486925]
−
{{#set: centisome position=12.58539   }}
+
* DRUGBANK : DB03756
−
{{#set: reaction associated=DNA-DIRECTED-DNA-POLYMERASE-RXN}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77016 77016]
 +
* HMDB : HMDB02183
 +
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-]}}
 +
{{#set: common name=docosahexaenoate}}
 +
{{#set: inchi key=InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M}}
 +
{{#set: molecular weight=327.486   }}
 +
{{#set: common name=docosahexaenoic acid|DHA|all-cis-docosa-4,7,10,13,16,19-hexaenoate|(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate|(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate}}
 +
{{#set: produced by=RXN-16138|RXN-16017}}
 +
{{#set: reversible reaction associated=RXN-16063}}

Revision as of 17:01, 21 March 2018

Metabolite CPD-10244

  • smiles:
    • CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-]
  • common name:
    • docosahexaenoate
  • inchi key:
    • InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M
  • molecular weight:
    • 327.486
  • Synonym(s):
    • docosahexaenoic acid
    • DHA
    • all-cis-docosa-4,7,10,13,16,19-hexaenoate
    • (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate
    • (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • LIPID_MAPS : LMFA01030185
  • PUBCHEM:
  • DRUGBANK : DB03756
  • CHEBI:
  • HMDB : HMDB02183
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=KDO2-LIPID-A&oldid=38073"