Difference between revisions of "UDP-D-XYLOSE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14493 RXN-14493] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-lesqueroloyl-CoA redu...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] == * smiles: ** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2)) * common name:...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14493 RXN-14493] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5881 CPD-5881] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))
 
* common name:
 
* common name:
−
** 3-oxo-lesqueroloyl-CoA reductase
+
** 4α-hydroxy-tetrahydrobiopterin
−
** chloroplast_beta-keto_acyl_reductase
+
* inchi key:
−
* ec number:
+
** InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N
−
** [http://enzyme.expasy.org/EC/1.1.1.330 EC-1.1.1.330]
+
* molecular weight:
 +
** 257.249   
 
* Synonym(s):
 
* Synonym(s):
 +
** 4α-hydroxy-5,6,7,8-tetrahydrobiopterin
 +
** 4α-hydroxy-tetrahydropterin
 +
** 6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7908]]
−
** 1 [[CPD-15368]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-15369]][c] '''+''' 1 [[NADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 3-oxo-lesqueroloyl-CoA[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 3R-hydroxy-lesqueroloyl-CoA[c] '''+''' 1 NADP+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_9871]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6433]], hydroxylated fatty acid biosynthesis (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6433 PWY-6433]
+
−
** '''4''' reactions found over '''22''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=3-oxo-lesqueroloyl-CoA reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657593 90657593]
−
{{#set: common name=chloroplast_beta-keto_acyl_reductase}}
+
* HMDB : HMDB02281
−
{{#set: ec number=EC-1.1.1.330}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_9871}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15374 15374]
−
{{#set: in pathway=PWY-6433}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15522 C15522]
−
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
+
{{#set: smiles=CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=4α-hydroxy-tetrahydrobiopterin}}
 +
{{#set: inchi key=InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N}}
 +
{{#set: molecular weight=257.249    }}
 +
{{#set: common name=4α-hydroxy-5,6,7,8-tetrahydrobiopterin|4α-hydroxy-tetrahydropterin|6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin}}
 +
{{#set: consumed by=RXN-7908}}

Revision as of 16:02, 21 March 2018

Metabolite CPD-5881

  • smiles:
    • CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))
  • common name:
    • 4α-hydroxy-tetrahydrobiopterin
  • inchi key:
    • InChIKey=KJKIEFUPAPPGBC-ATDKUNPGSA-N
  • molecular weight:
    • 257.249
  • Synonym(s):
    • 4α-hydroxy-5,6,7,8-tetrahydrobiopterin
    • 4α-hydroxy-tetrahydropterin
    • 6R)-6-(L-erythro-1,2-dihydroxypropyl)-5,6,7,8-tetrahydro-4α-hydroxypterin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(O)C(O)[CH]1(CNC2(=NC(N)=NC(=O)C(O)(N1)2))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=UDP-D-XYLOSE&oldid=38196"