Difference between revisions of "RXN-1106"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-318 RXN66-318] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GDP-L-GALACTOSE GDP-L-GALACTOSE] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O |
| − | * | + | * common name: |
| − | ** | + | ** GDP-β-L-galactose |
| + | * inchi key: | ||
| + | ** InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L | ||
| + | * molecular weight: | ||
| + | ** 603.329 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-7772]] | |
| − | + | * [[RXN-1882]] | |
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * | + | |
| − | * | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200538 25200538] | |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61454 61454] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02280 C02280] |
| − | {{#set: | + | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O}} |
| + | {{#set: common name=GDP-β-L-galactose}} | ||
| + | {{#set: inchi key=InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L}} | ||
| + | {{#set: molecular weight=603.329 }} | ||
| + | {{#set: reversible reaction associated=RXN-7772|RXN-1882}} | ||
Revision as of 16:02, 21 March 2018
Contents
Metabolite GDP-L-GALACTOSE
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O
- common name:
- GDP-β-L-galactose
- inchi key:
- InChIKey=MVMSCBBUIHUTGJ-JGQUBWHWSA-L
- molecular weight:
- 603.329
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C3(C(C(C(N2(C1(=C(C(NC(=N1)N)=O)N=C2)))O3)O)O))OP(OP(OC4(C(C(C(C(O4)CO)O)O)O))([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
