Difference between revisions of "Tiso gene 13558"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8743 RXN-8743] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8563 CPD-8563] == * smiles: ** C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8563 CPD-8563] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R] |
| − | * | + | * common name: |
| − | ** | + | ** myosin light-chain phosphate |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[2.7.11.18-RXN]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * LIGAND-CPD: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03875 C03875] | |
| − | {{#set: | + | {{#set: smiles=C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R]}} |
| − | + | {{#set: common name=myosin light-chain phosphate}} | |
| − | + | {{#set: reversible reaction associated=2.7.11.18-RXN}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 17:02, 21 March 2018
Contents
Metabolite CPD-8563
- smiles:
- C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R]
- common name:
- myosin light-chain phosphate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIGAND-CPD:
"C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R" cannot be used as a page name in this wiki.
