Difference between revisions of "Tiso gene 13686"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.134-RXN 2.7.1.134-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ras-related_gtp-bin...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] == * smiles: ** C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O * inchi key: *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] == |
− | * | + | * smiles: |
− | ** | + | ** C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O |
+ | * inchi key: | ||
+ | ** InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** γ-L-glutamyl-glycylglycine |
− | * | + | * molecular weight: |
− | ** | + | ** 260.226 |
* Synonym(s): | * Synonym(s): | ||
+ | ** γ-L-Glu-Gly-Gly | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-18092]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: smiles=C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O}} | |
− | + | {{#set: inchi key=InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M}} | |
− | + | {{#set: common name=γ-L-glutamyl-glycylglycine}} | |
− | + | {{#set: molecular weight=260.226 }} | |
− | {{#set: | + | {{#set: common name=γ-L-Glu-Gly-Gly}} |
− | {{#set: common name= | + | {{#set: produced by=RXN-18092}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Revision as of 16:19, 10 January 2018
Contents
Metabolite CPD-19395
- smiles:
- C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O
- inchi key:
- InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M
- common name:
- γ-L-glutamyl-glycylglycine
- molecular weight:
- 260.226
- Synonym(s):
- γ-L-Glu-Gly-Gly
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O" cannot be used as a page name in this wiki.