Difference between revisions of "CPD-452"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=Forthi Forthi] == * direction: ** LEFT-TO-RIGHT * common name: ** formate transport out via proton...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE-15-P2 D-RIBULOSE-15-P2] == * smiles: ** C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-]...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=Forthi Forthi] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE-15-P2 D-RIBULOSE-15-P2] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-]
 
* common name:
 
* common name:
−
** formate transport out via proton symport, chloroplast
+
** D-ribulose-1,5-bisphosphate
 +
* inchi key:
 +
** InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J
 +
* molecular weight:
 +
** 306.059   
 
* Synonym(s):
 
* Synonym(s):
 +
** ribulose 1,5-bisphosphate
 +
** D-ribulose-1,5-diphosphate
 +
** D-ribulose-1,5-P2
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
−
** 1.0 [[FORMATE]][h] '''+''' 1.0 [[PROTON]][h] '''=>''' 1.0 [[FORMATE]][c] '''+''' 1.0 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 formate[h] '''+''' 1.0 H+[h] '''=>''' 1.0 formate[c] '''+''' 1.0 H+[c]
+
* [[PHOSPHORIBULOKINASE-RXN]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_13706]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 14689-84-0
−
{{#set: common name=formate transport out via proton symport, chloroplast}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_13706}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615473 23615473]
−
{{#set: in pathway=}}
+
* CHEMSPIDER:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.chemspider.com/Chemical-Structure.3541504.html 3541504]
−
{{#set: reconstruction source=orthology-creinhardtii}}
+
* CHEBI:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57870 57870]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01182 C01182]
 +
{{#set: smiles=C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-]}}
 +
{{#set: common name=D-ribulose-1,5-bisphosphate}}
 +
{{#set: inchi key=InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J}}
 +
{{#set: molecular weight=306.059    }}
 +
{{#set: common name=ribulose 1,5-bisphosphate|D-ribulose-1,5-diphosphate|D-ribulose-1,5-P2}}
 +
{{#set: consumed by=RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN}}
 +
{{#set: reversible reaction associated=PHOSPHORIBULOKINASE-RXN}}

Revision as of 16:03, 21 March 2018

Metabolite D-RIBULOSE-15-P2

  • smiles:
    • C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-]
  • common name:
    • D-ribulose-1,5-bisphosphate
  • inchi key:
    • InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J
  • molecular weight:
    • 306.059
  • Synonym(s):
    • ribulose 1,5-bisphosphate
    • D-ribulose-1,5-diphosphate
    • D-ribulose-1,5-P2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-452&oldid=38430"