Difference between revisions of "N-ACETYL-D-GLUCOSAMINE-6-P"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_342 == * Synonym(s): == Reactions associated == * NAD+-ADP-RIBOSYLTRANSFERASE-RXN ** in-silico_annotation ***ec-number == Pathways ass...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] == * smiles: ** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3)) * c...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] == |
+ | * smiles: | ||
+ | ** COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3)) | ||
+ | * common name: | ||
+ | ** 3-O-methylkaempferol | ||
+ | * inchi key: | ||
+ | ** InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N | ||
+ | * molecular weight: | ||
+ | ** 300.267 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** kaempferol 3-methyl ether | ||
+ | ** 3-Methoxyapigenin | ||
+ | ** isokaempferide | ||
+ | ** 3-methylkaempferol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-13935]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280862 5280862] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1579 1579] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05902 C05902] | ||
+ | {{#set: smiles=COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))}} | ||
+ | {{#set: common name=3-O-methylkaempferol}} | ||
+ | {{#set: inchi key=InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=300.267 }} | ||
+ | {{#set: common name=kaempferol 3-methyl ether|3-Methoxyapigenin|isokaempferide|3-methylkaempferol}} | ||
+ | {{#set: produced by=RXN-13935}} |
Revision as of 16:03, 21 March 2018
Contents
Metabolite CPD-14950
- smiles:
- COC3(C(=O)C1(C(=CC(O)=CC(O)=1)OC(C2(C=CC(O)=CC=2))=3))
- common name:
- 3-O-methylkaempferol
- inchi key:
- InChIKey=VJJZJBUCDWKPLC-UHFFFAOYSA-N
- molecular weight:
- 300.267
- Synonym(s):
- kaempferol 3-methyl ether
- 3-Methoxyapigenin
- isokaempferide
- 3-methylkaempferol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links