Difference between revisions of "PWY-6269"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13686 == * Synonym(s): == Reactions associated == * RIBOFLAVIN-SYN-RXN ** pantograph-athaliana ** pantograph-synechocyst...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2107 CPD0-2107] == * smiles: ** CCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)O...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2107 CPD0-2107] == |
| + | * smiles: | ||
| + | ** CCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O | ||
| + | * inchi key: | ||
| + | ** InChIKey=IJFLXRCJWPKGKJ-LXIXEQKWSA-J | ||
| + | * common name: | ||
| + | ** (S)-3-hydroxydodecanoyl-CoA | ||
| + | * molecular weight: | ||
| + | ** 961.807 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[HACD5m]] | |
| − | + | * [[HACD5]] | |
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05262 C05262] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62558 62558] | ||
| + | * BIGG : 3hddcoa | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173081 46173081] | ||
| + | * HMDB : HMDB03936 | ||
| + | {{#set: smiles=CCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}} | ||
| + | {{#set: inchi key=InChIKey=IJFLXRCJWPKGKJ-LXIXEQKWSA-J}} | ||
| + | {{#set: common name=(S)-3-hydroxydodecanoyl-CoA}} | ||
| + | {{#set: molecular weight=961.807 }} | ||
| + | {{#set: consumed or produced by=HACD5m|HACD5}} | ||
Revision as of 16:19, 10 January 2018
Contents
Metabolite CPD0-2107
- smiles:
- CCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
- inchi key:
- InChIKey=IJFLXRCJWPKGKJ-LXIXEQKWSA-J
- common name:
- (S)-3-hydroxydodecanoyl-CoA
- molecular weight:
- 961.807
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O" cannot be used as a page name in this wiki.
