Difference between revisions of "Tiso gene 12988"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-162 RXN1F-162] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-162 RXN1F-162] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.14.11 EC-1.14.11]
+
** zeinoxanthin
 +
* inchi key:
 +
** InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N
 +
* molecular weight:
 +
** 552.882   
 
* Synonym(s):
 
* Synonym(s):
 +
** β,ε-carotene-3-ol
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-5962]]
−
** 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD1F-95]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[SUC]][c] '''+''' 1 [[CPD1F-97]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-5961]]
−
** 1 2-oxoglutarate[c] '''+''' 1 oxygen[c] '''+''' 1 gibberellin A12[c] '''=>''' 1 CO2[c] '''+''' 1 succinate[c] '''+''' 1 gibberellin A15 (open lactone form)[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3330]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-5070]], gibberellin biosynthesis I (non C-3, non C-13 hydroxylation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5070 PWY-5070]
+
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-athaliana]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R06322 R06322]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10311902 10311902]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEMSPIDER:
−
{{#set: ec number=EC-1.14.11}}
+
** [http://www.chemspider.com/Chemical-Structure.8487368.html 8487368]
−
{{#set: gene associated=Tiso_gene_3330}}
+
* CHEBI:
−
{{#set: in pathway=PWY-5070}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65244 65244]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08590 C08590]
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C}}
 +
{{#set: common name=zeinoxanthin}}
 +
{{#set: inchi key=InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N}}
 +
{{#set: molecular weight=552.882    }}
 +
{{#set: common name=β,ε-carotene-3-ol}}
 +
{{#set: consumed by=RXN-5962}}
 +
{{#set: produced by=RXN-5961}}

Revision as of 16:05, 21 March 2018

Metabolite CPD-5661

  • smiles:
    • CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C
  • common name:
    • zeinoxanthin
  • inchi key:
    • InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N
  • molecular weight:
    • 552.882
  • Synonym(s):
    • β,ε-carotene-3-ol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12988&oldid=38630"